Difference between revisions of "Tiso gene 14122"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-ENOLPYRUVYL-SHIKIMATE-5P 3-ENOLPYRUVYL-SHIKIMATE-5P] == * smiles: ** C=C(C(=O)[O-])OC1(CC(C(=...")
(Created page with "Category:Gene == Gene Tiso_gene_14122 == * right end position: ** 4894 * transcription direction: ** POSITIVE * left end position: ** 2133 * centisome position: ** 36.5803...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-ENOLPYRUVYL-SHIKIMATE-5P 3-ENOLPYRUVYL-SHIKIMATE-5P] ==
+
== Gene Tiso_gene_14122 ==
−
* smiles:
+
* right end position:
−
** C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)
+
** 4894
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QUTYKIXIUDQOLK-PRJMDXOYSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 5-enolpyruvoyl-shikimate 3-phosphate
+
** 2133
−
* molecular weight:
+
* centisome position:
−
** 320.149    
+
** 36.580345    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-enolpyruvyl-shikimate 5-phosphate
 
−
** 3-enolpyruvyl-shikimate-5-P
 
−
** 5-O-(1-carboxyvinyl)-3-phosphoshikimate
 
−
** 5-enolpyruvyl-shikimate 3-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[CHORISMATE-SYNTHASE-RXN]]
+
* Reaction: [[3.2.1.52-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
−
* [[2.5.1.19-RXN]]
+
* Reaction: [[RXN-12625]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
* Reaction: [[RXN-12626]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-18082]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-5226]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7822]]
 +
* [[PWY-6902]]
 +
* [[PWY0-1261]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=4894}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506801 14506801]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=2133}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57701 57701]
+
{{#set: centisome position=36.580345   }}
−
* BIGG : 3psme
+
{{#set: reaction associated=3.2.1.52-RXN|RXN-12625|RXN-12626|RXN-18082|RXN0-5226}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-7822|PWY-6902|PWY0-1261}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01269 C01269]
+
−
{{#set: smiles=C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)}}
+
−
{{#set: inchi key=InChIKey=QUTYKIXIUDQOLK-PRJMDXOYSA-J}}
+
−
{{#set: common name=5-enolpyruvoyl-shikimate 3-phosphate}}
+
−
{{#set: molecular weight=320.149   }}
+
−
{{#set: common name=3-enolpyruvyl-shikimate 5-phosphate|3-enolpyruvyl-shikimate-5-P|5-O-(1-carboxyvinyl)-3-phosphoshikimate|5-enolpyruvyl-shikimate 3-phosphate}}
+
−
{{#set: consumed by=CHORISMATE-SYNTHASE-RXN}}
+
−
{{#set: consumed or produced by=2.5.1.19-RXN}}
+

Latest revision as of 20:32, 21 March 2018

Gene Tiso_gene_14122

  • right end position:
    • 4894
  • transcription direction:
    • POSITIVE
  • left end position:
    • 2133
  • centisome position:
    • 36.580345
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14122&oldid=42232"