Difference between revisions of "CPD-12829"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta11-melissoyl-ACPs cis-delta11-melissoyl-ACPs] == * common name: ** a cis-delta11-C30:1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12829 CPD-12829] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(C)=CC...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12829 CPD-12829] == |
+ | * smiles: | ||
+ | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(C)=CCCC(C)=CCC1(=CC(=C(C(=C1O)C)C)O))C)C)C | ||
* common name: | * common name: | ||
− | ** | + | ** plastoquinol-9 |
+ | * inchi key: | ||
+ | ** InChIKey=IJBLJLREWPLEPB-IQSNHBBHSA-N | ||
+ | * molecular weight: | ||
+ | ** 751.23 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-2762]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16695 C16695] |
− | {{#set: produced by= | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.4945177.html 4945177] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28026 28026] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6440941 6440941] | ||
+ | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(C)=CCCC(C)=CCC1(=CC(=C(C(=C1O)C)C)O))C)C)C}} | ||
+ | {{#set: common name=plastoquinol-9}} | ||
+ | {{#set: inchi key=InChIKey=IJBLJLREWPLEPB-IQSNHBBHSA-N}} | ||
+ | {{#set: molecular weight=751.23 }} | ||
+ | {{#set: produced by=RXN-2762}} |
Latest revision as of 19:32, 21 March 2018
Contents
Metabolite CPD-12829
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(C)=CCCC(C)=CCC1(=CC(=C(C(=C1O)C)C)O))C)C)C
- common name:
- plastoquinol-9
- inchi key:
- InChIKey=IJBLJLREWPLEPB-IQSNHBBHSA-N
- molecular weight:
- 751.23
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links