Difference between revisions of "CPD-8259"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cerebrosides Cerebrosides] == * common name: ** a cerebroside * Synonym(s): ** a monoglycosylce...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8259 CPD-8259] == * smiles: ** C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2)) * common na...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8259 CPD-8259] == |
+ | * smiles: | ||
+ | ** C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2)) | ||
* common name: | * common name: | ||
− | ** | + | ** β-D-ribosylnicotinate |
+ | * inchi key: | ||
+ | ** InChIKey=PUEDDPCUCPRQNY-ZYUZMQFOSA-N | ||
+ | * molecular weight: | ||
+ | ** 255.227 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** nicotinic acid riboside |
+ | ** ribosylnicotinate | ||
+ | ** nicotinic acid ribose | ||
+ | ** nicotinate riboside | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-8443]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-14227]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[NRPH]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05841 C05841] |
− | {{#set: consumed by= | + | * HMDB : HMDB06809 |
− | {{#set: produced by= | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58527 58527] | ||
+ | * METABOLIGHTS : MTBLC58527 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=161233 161233] | ||
+ | {{#set: smiles=C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2))}} | ||
+ | {{#set: common name=β-D-ribosylnicotinate}} | ||
+ | {{#set: inchi key=InChIKey=PUEDDPCUCPRQNY-ZYUZMQFOSA-N}} | ||
+ | {{#set: molecular weight=255.227 }} | ||
+ | {{#set: common name=nicotinic acid riboside|ribosylnicotinate|nicotinic acid ribose|nicotinate riboside}} | ||
+ | {{#set: consumed by=RXN-8443}} | ||
+ | {{#set: produced by=RXN-14227}} | ||
+ | {{#set: reversible reaction associated=NRPH}} |
Latest revision as of 20:32, 21 March 2018
Contents
Metabolite CPD-8259
- smiles:
- C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2))
- common name:
- β-D-ribosylnicotinate
- inchi key:
- InChIKey=PUEDDPCUCPRQNY-ZYUZMQFOSA-N
- molecular weight:
- 255.227
- Synonym(s):
- nicotinic acid riboside
- ribosylnicotinate
- nicotinic acid ribose
- nicotinate riboside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2))" cannot be used as a page name in this wiki.