Difference between revisions of "CPD-10055"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-499 RXN1G-499] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-lignoceroyl-[acyl-car...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10055 CPD-10055] == * smiles: ** C=C(C1(CC(C(CC1)(O)C)O))C * common name: ** (1R,2R,4S)-lim...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-499 RXN1G-499] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10055 CPD-10055] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C=C(C1(CC(C(CC1)(O)C)O))C
 
* common name:
 
* common name:
** 3-oxo-lignoceroyl-[acyl-carrier protein] synthase
+
** (1R,2R,4S)-limonene-1,2-diol
** 3-oxoacyl-synthase
+
* inchi key:
* ec number:
+
** InChIKey=WKZWTZTZWGWEGE-IVZWLZJFSA-N
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
+
* molecular weight:
 +
** 170.251   
 
* Synonym(s):
 
* Synonym(s):
 +
** (1S,2S,4R)-menth-8-ene-1,2-diol
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[MALONYL-COA]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Behenoyl-ACPs]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[3-oxo-lignoceroyl-ACPs]][c]
+
* [[RXN-9413]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 malonyl-CoA[c] '''+''' 1 H+[c] '''+''' 1 a behenoyl-[acp][c] '''=>''' 1 CO2[c] '''+''' 1 coenzyme A[c] '''+''' 1 a 3-oxo-lignoceroyl-[acp][c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_5939]]
+
** IN-SILICO_ANNOTATION
+
***EC-NUMBER
+
** EXPERIMENTAL_ANNOTATION
+
***EC-NUMBER
+
* [[Tiso_gene_15991]]
+
** [[pantograph]]-[[esiliculosus]]
+
* [[Tiso_gene_14485]]
+
** [[pantograph]]-[[esiliculosus]]
+
* [[Tiso_gene_19302]]
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways  ==
+
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
+
** '''86''' reactions found over '''182''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[esiliculosus]]
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[experimental_annotation]]
+
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
{{#set: common name=3-oxo-lignoceroyl-[acyl-carrier protein] synthase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C19082 C19082]
{{#set: common name=3-oxoacyl-synthase}}
+
* CHEMSPIDER:
{{#set: ec number=EC-2.3.1.41}}
+
** [http://www.chemspider.com/Chemical-Structure.9392549.html 9392549]
{{#set: gene associated=Tiso_gene_5939|Tiso_gene_15991|Tiso_gene_14485|Tiso_gene_19302}}
+
* CHEBI:
{{#set: in pathway=PWYG-321}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50244 50244]
{{#set: reconstruction category=orthology}}
+
* PUBCHEM:
{{#set: reconstruction tool=pantograph}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11217495 11217495]
{{#set: reconstruction source=esiliculosus}}
+
{{#set: smiles=C=C(C1(CC(C(CC1)(O)C)O))C}}
{{#set: reconstruction category=annotation}}
+
{{#set: common name=(1R,2R,4S)-limonene-1,2-diol}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=WKZWTZTZWGWEGE-IVZWLZJFSA-N}}
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
{{#set: molecular weight=170.251    }}
 +
{{#set: common name=(1S,2S,4R)-menth-8-ene-1,2-diol}}
 +
{{#set: produced by=RXN-9413}}

Latest revision as of 20:33, 21 March 2018

Metabolite CPD-10055

  • smiles:
    • C=C(C1(CC(C(CC1)(O)C)O))C
  • common name:
    • (1R,2R,4S)-limonene-1,2-diol
  • inchi key:
    • InChIKey=WKZWTZTZWGWEGE-IVZWLZJFSA-N
  • molecular weight:
    • 170.251
  • Synonym(s):
    • (1S,2S,4R)-menth-8-ene-1,2-diol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links