Difference between revisions of "CPD-10055"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-499 RXN1G-499] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-lignoceroyl-[acyl-car...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10055 CPD-10055] == * smiles: ** C=C(C1(CC(C(CC1)(O)C)O))C * common name: ** (1R,2R,4S)-lim...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10055 CPD-10055] == |
− | * | + | * smiles: |
− | ** | + | ** C=C(C1(CC(C(CC1)(O)C)O))C |
* common name: | * common name: | ||
− | ** | + | ** (1R,2R,4S)-limonene-1,2-diol |
− | ** | + | * inchi key: |
− | * | + | ** InChIKey=WKZWTZTZWGWEGE-IVZWLZJFSA-N |
− | ** | + | * molecular weight: |
+ | ** 170.251 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (1S,2S,4R)-menth-8-ene-1,2-diol | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-9413]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C19082 C19082] | |
− | + | * CHEMSPIDER: | |
− | + | ** [http://www.chemspider.com/Chemical-Structure.9392549.html 9392549] | |
− | + | * CHEBI: | |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50244 50244] | |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11217495 11217495] |
− | {{#set: | + | {{#set: smiles=C=C(C1(CC(C(CC1)(O)C)O))C}} |
− | {{#set: | + | {{#set: common name=(1R,2R,4S)-limonene-1,2-diol}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=WKZWTZTZWGWEGE-IVZWLZJFSA-N}} |
− | {{#set: | + | {{#set: molecular weight=170.251 }} |
+ | {{#set: common name=(1S,2S,4R)-menth-8-ene-1,2-diol}} | ||
+ | {{#set: produced by=RXN-9413}} |
Latest revision as of 20:33, 21 March 2018
Contents
Metabolite CPD-10055
- smiles:
- C=C(C1(CC(C(CC1)(O)C)O))C
- common name:
- (1R,2R,4S)-limonene-1,2-diol
- inchi key:
- InChIKey=WKZWTZTZWGWEGE-IVZWLZJFSA-N
- molecular weight:
- 170.251
- Synonym(s):
- (1S,2S,4R)-menth-8-ene-1,2-diol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links