Difference between revisions of "CPD-714"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_11399 == * left end position: ** 441 * transcription direction: ** NEGATIVE * right end position: ** 3463 * centisome position: ** 5.645884...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
− | * | + | * common name: |
− | ** | + | ** cathasterone |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 432.685 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-716]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-715]] |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15341086 15341086] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=23057 23057] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C15790 C15790] | ||
+ | {{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
+ | {{#set: common name=cathasterone}} | ||
+ | {{#set: inchi key=InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N}} | ||
+ | {{#set: molecular weight=432.685 }} | ||
+ | {{#set: consumed by=RXN-716}} | ||
+ | {{#set: produced by=RXN-715}} |
Latest revision as of 20:16, 21 March 2018
Contents
Metabolite CPD-714
- smiles:
- CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- cathasterone
- inchi key:
- InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N
- molecular weight:
- 432.685
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.