Difference between revisions of "PTEROATE"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6381 PWY-6381] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PTEROATE PTEROATE] == * smiles: ** C(NC1(C=CC(C(=O)[O-])=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3))...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PTEROATE PTEROATE] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(NC1(C=CC(C(=O)[O-])=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3)) |
* common name: | * common name: | ||
| − | ** | + | ** pteroate |
| + | * inchi key: | ||
| + | ** InChIKey=JOAQINSXLLMRCV-UHFFFAOYSA-M | ||
| + | * molecular weight: | ||
| + | ** 311.279 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 4-{[(2-amino-4-hydroxypteridin-6-yl)methyl]amino}benzoate | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[3.4.17.11-RXN]] | |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 119-24-4 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6951470 6951470] |
| − | {{#set: | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.5324366.html 5324366] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38793 38793] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C07582 C07582] | ||
| + | {{#set: smiles=C(NC1(C=CC(C(=O)[O-])=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3))}} | ||
| + | {{#set: common name=pteroate}} | ||
| + | {{#set: inchi key=InChIKey=JOAQINSXLLMRCV-UHFFFAOYSA-M}} | ||
| + | {{#set: molecular weight=311.279 }} | ||
| + | {{#set: common name=4-{[(2-amino-4-hydroxypteridin-6-yl)methyl]amino}benzoate}} | ||
| + | {{#set: produced by=3.4.17.11-RXN}} | ||
Latest revision as of 20:34, 21 March 2018
Contents
Metabolite PTEROATE
- smiles:
- C(NC1(C=CC(C(=O)[O-])=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3))
- common name:
- pteroate
- inchi key:
- InChIKey=JOAQINSXLLMRCV-UHFFFAOYSA-M
- molecular weight:
- 311.279
- Synonym(s):
- 4-{[(2-amino-4-hydroxypteridin-6-yl)methyl]amino}benzoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(NC1(C=CC(C(=O)[O-])=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3))" cannot be used as a page name in this wiki.
"4-{[(2-amino-4-hydroxypteridin-6-yl)methyl]amino}benzoate" cannot be used as a page name in this wiki.
