Difference between revisions of "TRANS-23-DEHYDROADIPYL-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14601 CPD-14601] == * smiles: ** CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC) * i...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-23-DEHYDROADIPYL-COA TRANS-23-DEHYDROADIPYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)N...") |
||
| (4 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-23-DEHYDROADIPYL-COA TRANS-23-DEHYDROADIPYL-COA] == |
* smiles: | * smiles: | ||
| − | ** CC( | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C=CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** trans-2,3-dehydroadipyl-coA |
| + | * inchi key: | ||
| + | ** InChIKey=ZFXICKRXPZTFPB-KCQRSJHASA-I | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 888.606 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** cis-2,3-didehydroadipyl-CoA |
| + | ** 2,3-didehydroadipyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-2425]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70679154 70679154] |
| + | * HMDB : HMDB60392 | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71044 71044] |
| − | {{#set: smiles=CC( | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C14144 C14144] |
| − | {{#set: | + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C=CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: molecular weight= | + | {{#set: common name=trans-2,3-dehydroadipyl-coA}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=ZFXICKRXPZTFPB-KCQRSJHASA-I}} |
| − | {{#set: | + | {{#set: molecular weight=888.606 }} |
| + | {{#set: common name=cis-2,3-didehydroadipyl-CoA|2,3-didehydroadipyl-CoA}} | ||
| + | {{#set: reversible reaction associated=RXN-2425}} | ||
Latest revision as of 19:16, 21 March 2018
Contents
Metabolite TRANS-23-DEHYDROADIPYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C=CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- trans-2,3-dehydroadipyl-coA
- inchi key:
- InChIKey=ZFXICKRXPZTFPB-KCQRSJHASA-I
- molecular weight:
- 888.606
- Synonym(s):
- cis-2,3-didehydroadipyl-CoA
- 2,3-didehydroadipyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C=CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
