Difference between revisions of "Tiso gene 4026"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=44-DIMETHYL-CHOLESTA-812-24-TRIENOL 44-DIMETHYL-CHOLESTA-812-24-TRIENOL] == * smiles: ** CC(C)=...")
(Created page with "Category:Gene == Gene Tiso_gene_4026 == * right end position: ** 7309 * transcription direction: ** POSITIVE * left end position: ** 4252 * centisome position: ** 27.30892...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=44-DIMETHYL-CHOLESTA-812-24-TRIENOL 44-DIMETHYL-CHOLESTA-812-24-TRIENOL] ==
+
== Gene Tiso_gene_4026 ==
* smiles:
+
* right end position:
** CC(C)=CCCC([CH]1(C2(C)(C(=CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
+
** 7309
* inchi key:
+
* transcription direction:
** InChIKey=LFQXEZVYNCBVDO-PBJLWWPKSA-N
+
** POSITIVE
* common name:
+
* left end position:
** 4,4-dimethyl-cholesta-8,12,24-trienol
+
** 4252
* molecular weight:
+
* centisome position:
** 410.682    
+
** 27.308926    
 
* Synonym(s):
 
* Synonym(s):
** 17-(1,5-dimethylhex-4-enyl)-4,4,10,13-tetramethyl-2,3,4,5,6,7, 10,11,12,13,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol
 
** 4,4-dimethyl-5α-cholesta-8,14,24-trien-3β-ol
 
** 4,4-dimethyl-5-α-cholesta-8,14,24-trien-3-β-ol
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN66-306]]
+
* Reaction: [[ATPASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN3O-130]]
+
*** Assignment: ec-number
* [[RXN66-305]]
+
* Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12195]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12196]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-5462]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7184]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7210]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=7309}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=443212 443212]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: left end position=4252}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17813 17813]
+
{{#set: centisome position=27.308926   }}
* LIGAND-CPD:
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
** [http://www.genome.jp/dbget-bin/www_bget?C11455 C11455]
+
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
* HMDB : HMDB01023
+
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(=CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
+
{{#set: inchi key=InChIKey=LFQXEZVYNCBVDO-PBJLWWPKSA-N}}
+
{{#set: common name=4,4-dimethyl-cholesta-8,12,24-trienol}}
+
{{#set: molecular weight=410.682   }}
+
{{#set: common name=17-(1,5-dimethylhex-4-enyl)-4,4,10,13-tetramethyl-2,3,4,5,6,7, 10,11,12,13,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol|4,4-dimethyl-5α-cholesta-8,14,24-trien-3β-ol|4,4-dimethyl-5-α-cholesta-8,14,24-trien-3-β-ol}}
+
{{#set: consumed by=RXN66-306}}
+
{{#set: produced by=RXN3O-130|RXN66-305}}
+

Latest revision as of 19:34, 21 March 2018

Gene Tiso_gene_4026

  • right end position:
    • 7309
  • transcription direction:
    • POSITIVE
  • left end position:
    • 4252
  • centisome position:
    • 27.308926
  • Synonym(s):

Reactions associated

Pathways associated

External links