Difference between revisions of "PWY-5923"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-667 CPD-667] == * smiles: ** CC(OCCC(C([O-])=O)[N+])=O * inchi key: ** InChIKey=FCXZBWSIAGG...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5923 PWY-5923] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5923 PWY-5923] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** limonene degradation I (D-limonene) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (+)-limonene degradation |
| − | ** | + | ** (+)-(4R)-limonene degradation |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''7''' reactions in the full pathway |
| − | * [[ | + | * [[3.3.2.8-RXN]] |
| − | + | ** 1 associated gene(s): | |
| − | == Reaction(s) | + | *** [[Tiso_gene_15422]] |
| − | * [[ | + | ** 1 reconstruction source(s) associated: |
| − | * [ | + | *** [[annotation-in-silico_annotation]] |
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9406 RXN-9406] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9407 RXN-9407] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9410 RXN-9410] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9415 RXN-9415] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9417 RXN-9417] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9949 RXN-9949] | ||
== External links == | == External links == | ||
| − | * | + | * UM-BBD-PWY : lim |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=limonene degradation I (D-limonene)}} | |
| − | + | {{#set: common name=(+)-limonene degradation|(+)-(4R)-limonene degradation}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=7}} | |
| − | + | {{#set: completion rate=14.0}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:34, 21 March 2018
Pathway PWY-5923
- taxonomic range:
- common name:
- limonene degradation I (D-limonene)
- Synonym(s):
- (+)-limonene degradation
- (+)-(4R)-limonene degradation
Reaction(s) found
1 reactions found over 7 reactions in the full pathway
- 3.3.2.8-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- UM-BBD-PWY : lim
