Difference between revisions of "Tiso gene 18433"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] == * smiles: ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(...")
(Created page with "Category:Gene == Gene Tiso_gene_18433 == * Synonym(s): == Reactions associated == * Reaction: 5FLURAt ** Source: orthology-creinhardtii * Reaction: 6MPURt **...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] ==
+
== Gene Tiso_gene_18433 ==
−
* smiles:
+
−
** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
+
−
* inchi key:
+
−
** InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L
+
−
* common name:
+
−
** 15,16-dihydrobiliverdin
+
−
* molecular weight:
+
−
** 582.655   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[1.3.7.3-RXN]]
+
* Reaction: [[5FLURAt]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-creinhardtii]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[6MPURt]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[TGUAt]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[URATEt]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[URATEtm]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: reaction associated=5FLURAt|6MPURt|TGUAt|URATEt|URATEtm}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243901 25243901]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57899 57899]
+
−
{{#set: smiles=C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}}
+
−
{{#set: inchi key=InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L}}
+
−
{{#set: common name=15,16-dihydrobiliverdin}}
+
−
{{#set: molecular weight=582.655    }}
+
−
{{#set: consumed by=1.3.7.3-RXN}}
+

Latest revision as of 19:35, 21 March 2018

Gene Tiso_gene_18433

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18433&oldid=42553"