Difference between revisions of "PLASMENYLCHOLINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1718 CPD0-1718] == * smiles: ** C1(=NC2(=C(NC1)N=C(N)NC(=O)2)) * inchi key: ** InChIKey=PX...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PLASMENYLCHOLINE PLASMENYLCHOLINE] == * common name: ** a plasmenylcholine * Synonym(s): ** an...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1718 CPD0-1718] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PLASMENYLCHOLINE PLASMENYLCHOLINE] ==
* smiles:
+
** C1(=NC2(=C(NC1)N=C(N)NC(=O)2))
+
* inchi key:
+
** InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 7,8-dihydropterin
+
** a plasmenylcholine
* molecular weight:
+
** 165.154   
+
 
* Synonym(s):
 
* Synonym(s):
** dihydropterin
+
** an O-1-Z-alk-1-enyl-2-acyl-sn-glycero-3-phosphocholine
** H2-pterin
+
** a choline plasmalogen
 +
** a 1-Z-alkenyl-2-acylglycerophosphocholine
 +
** a 1-Z-alkenyl-2-acyl-sn-glycero-3-phosphocholine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15261]]
+
* [[RXN-17736]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a plasmenylcholine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65260 65260]
+
{{#set: common name=an O-1-Z-alk-1-enyl-2-acyl-sn-glycero-3-phosphocholine|a choline plasmalogen|a 1-Z-alkenyl-2-acylglycerophosphocholine|a 1-Z-alkenyl-2-acyl-sn-glycero-3-phosphocholine}}
* CHEMSPIDER:
+
{{#set: consumed by=RXN-17736}}
** [http://www.chemspider.com/Chemical-Structure.58752.html 58752]
+
{{#set: smiles=C1(=NC2(=C(NC1)N=C(N)NC(=O)2))}}
+
{{#set: inchi key=InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N}}
+
{{#set: common name=7,8-dihydropterin}}
+
{{#set: molecular weight=165.154    }}
+
{{#set: common name=dihydropterin|H2-pterin}}
+
{{#set: consumed by=RXN-15261}}
+

Latest revision as of 19:35, 21 March 2018

Metabolite PLASMENYLCHOLINE

  • common name:
    • a plasmenylcholine
  • Synonym(s):
    • an O-1-Z-alk-1-enyl-2-acyl-sn-glycero-3-phosphocholine
    • a choline plasmalogen
    • a 1-Z-alkenyl-2-acylglycerophosphocholine
    • a 1-Z-alkenyl-2-acyl-sn-glycero-3-phosphocholine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links