Difference between revisions of "PWY4FS-11"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15374 CPD-15374] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * inchi key: ** InChIKey=GZCGUP...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-11 PWY4FS-11] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-11 PWY4FS-11] == |
| − | * | + | * taxonomic range: |
| − | ** [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-ascorbate biosynthesis II (L-gulose pathway) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** vitamin C biosynthesis |
| − | ** | + | ** L-ascorbic acid biosynthesis II |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''1''' reactions found over '''5''' reactions in the full pathway |
| − | == Reaction(s) | + | * [[RXN-7771]] |
| − | == | + | ** 1 associated gene(s): |
| + | *** [[Tiso_gene_6621]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14395 RXN-14395] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN4FS-10 RXN4FS-10] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN4FS-8 RXN4FS-8] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN4FS-9 RXN4FS-9] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | + | {{#set: common name=L-ascorbate biosynthesis II (L-gulose pathway)}} | |
| − | + | {{#set: common name=vitamin C biosynthesis|L-ascorbic acid biosynthesis II}} | |
| − | + | {{#set: reaction found=1}} | |
| − | {{#set: | + | {{#set: total reaction=5}} |
| − | {{#set: | + | {{#set: completion rate=20.0}} |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:35, 21 March 2018
Pathway PWY4FS-11
- taxonomic range:
- common name:
- L-ascorbate biosynthesis II (L-gulose pathway)
- Synonym(s):
- vitamin C biosynthesis
- L-ascorbic acid biosynthesis II
Reaction(s) found
1 reactions found over 5 reactions in the full pathway
- RXN-7771
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
