Difference between revisions of "Tiso gene 15372"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3946 CPD-3946] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[...")
(Created page with "Category:Gene == Gene Tiso_gene_15372 == * right end position: ** 4184 * transcription direction: ** NEGATIVE * left end position: ** 132 * centisome position: ** 2.605606...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3946 CPD-3946] ==
+
== Gene Tiso_gene_15372 ==
−
* smiles:
+
* right end position:
−
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** 4184
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XGIZPVUTLMXXTK-VNSZYHACSA-N
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** (22S,24R)-22-hydroxy-5α-ergostan-3-one
+
** 132
−
* molecular weight:
+
* centisome position:
−
** 416.686    
+
** 2.605606    
 
* Synonym(s):
 
* Synonym(s):
−
** (22S)-22-hydroxy-5α-campestan-3-one
 
−
** (22α)-hydroxy-5α-campestan-3-one
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-15117]]
−
* [[RXN-4230]]
+
** Source: [[orthology-athaliana]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-5464]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7817]]
 +
* [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMST01031117
+
{{#set: right end position=4184}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878488 46878488]
+
{{#set: left end position=132}}
−
* CHEBI:
+
{{#set: centisome position=2.605606   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59411 59411]
+
{{#set: reaction associated=RXN-15117|RXN-5464}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-7817|MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15797 C15797]
+
−
* HMDB : HMDB12112
+
−
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=XGIZPVUTLMXXTK-VNSZYHACSA-N}}
+
−
{{#set: common name=(22S,24R)-22-hydroxy-5α-ergostan-3-one}}
+
−
{{#set: molecular weight=416.686   }}
+
−
{{#set: common name=(22S)-22-hydroxy-5α-campestan-3-one|(22α)-hydroxy-5α-campestan-3-one}}
+
−
{{#set: produced by=RXN-4230}}
+

Latest revision as of 19:35, 21 March 2018

Gene Tiso_gene_15372

  • right end position:
    • 4184
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 132
  • centisome position:
    • 2.605606
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15372&oldid=42567"