Difference between revisions of "TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUCROSE SUCROSE] == * smiles: ** C(C2(OC(OC1(OC(CO)C(C(O)1)O)CO)C(C(O)C2O)O))O * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN] == * direction: ** L...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ORF |
− | * | + | ** trna_(guanine-n-)-methyltransferase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/2.1.1.33 EC-2.1.1.33] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[Guanine46-in-tRNA]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[tRNA-Containing-N7-Methylguanine-46]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 a guanine46 in tRNA[c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 an N7-methylguanine46 in tRNA[c] '''+''' 1 S-adenosyl-L-homocysteine[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_14922]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_6175]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_5561]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_17963]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00600 R00600] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=ORF}} | |
− | + | {{#set: common name=trna_(guanine-n-)-methyltransferase}} | |
− | + | {{#set: ec number=EC-2.1.1.33}} | |
− | + | {{#set: gene associated=Tiso_gene_14922|Tiso_gene_6175|Tiso_gene_5561|Tiso_gene_17963}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | * LIGAND- | + | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:35, 21 March 2018
Contents
Reaction TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- ORF
- trna_(guanine-n-)-methyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Guanine46-in-tRNA[c] + 1 S-ADENOSYLMETHIONINE[c] => 1 tRNA-Containing-N7-Methylguanine-46[c] + 1 ADENOSYL-HOMO-CYS[c]
- With common name(s):
- 1 a guanine46 in tRNA[c] + 1 S-adenosyl-L-methionine[c] => 1 an N7-methylguanine46 in tRNA[c] + 1 S-adenosyl-L-homocysteine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14922
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_6175
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_5561
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_17963
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- LIGAND-RXN: