Difference between revisions of "5-L-GLUTAMYL-PEPTIDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINOLINATE QUINOLINATE] == * smiles: ** C1(=CC=C(C(C([O-])=O)=N1)C([O-])=O) * inchi key: ** In...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-L-GLUTAMYL-PEPTIDE 5-L-GLUTAMYL-PEPTIDE] == * common name: ** a 5-L-glutamyl-[peptide] * Syno...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-L-GLUTAMYL-PEPTIDE 5-L-GLUTAMYL-PEPTIDE] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a 5-L-glutamyl-[peptide] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a γ-L-glutamyl-[peptide] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GAMMA-GLUTAMYLTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a 5-L-glutamyl-[peptide]}} | |
| − | + | {{#set: common name=a γ-L-glutamyl-[peptide]}} | |
| − | + | {{#set: consumed by=GAMMA-GLUTAMYLTRANSFERASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: consumed by= | + | |
| − | + | ||
Latest revision as of 19:37, 21 March 2018
Contents
Metabolite 5-L-GLUTAMYL-PEPTIDE
- common name:
- a 5-L-glutamyl-[peptide]
- Synonym(s):
- a γ-L-glutamyl-[peptide]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a 5-L-glutamyl-[peptide" cannot be used as a page name in this wiki.
"a γ-L-glutamyl-[peptide" cannot be used as a page name in this wiki.
