Difference between revisions of "CPD-8355"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9531 RXN-9531] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-dodecanoyl-[acyl-carrie...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O * common n...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9531 RXN-9531] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O
 
* common name:
 
* common name:
−
** 3-oxo-dodecanoyl-[acyl-carrier protein] synthase
+
** 1-18:1-2-lysophosphatidylethanolamine
−
** 3-oxoacyl-synthase
+
* inchi key:
−
* ec number:
+
** InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N
−
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
+
* molecular weight:
 +
** 479.593   
 
* Synonym(s):
 
* Synonym(s):
 +
** 1-18:1-lysoPE
 +
** 1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-15035]]
−
** 1 [[MALONYL-ACP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Decanoyl-ACPs]][c] '''=>''' 1 [[ACP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[3-oxo-dodecanoyl-ACPs]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-15067]]
−
** 1 a malonyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 a decanoyl-[acp][c] '''=>''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 CO2[c] '''+''' 1 a 3-oxo-dodecanoyl-[acp][c]
+
== Reaction(s) of unknown directionality ==
−
 
+
* [[RXN-15036]]
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_14485]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_5939]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_19302]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_15991]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
+
−
** '''31''' reactions found over '''31''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[synechocystis]]
+
−
*** [[esiliculosus]]
+
−
*** [[athaliana]]
+
−
* [[manual]]:
+
−
** [[primary_network]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=3-oxo-dodecanoyl-[acyl-carrier protein] synthase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=58177709 58177709]
−
{{#set: common name=3-oxoacyl-synthase}}
+
* CHEBI:
−
{{#set: ec number=EC-2.3.1.41}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74971 74971]
−
{{#set: gene associated=Tiso_gene_14485|Tiso_gene_5939|Tiso_gene_19302|Tiso_gene_15991}}
+
* HMDB : HMDB11506
−
{{#set: in pathway=PWY-5971}}
+
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=1-18:1-2-lysophosphatidylethanolamine}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N}}
−
{{#set: reconstruction source=synechocystis|esiliculosus|athaliana}}
+
{{#set: molecular weight=479.593    }}
−
{{#set: reconstruction category=manual}}
+
{{#set: common name=1-18:1-lysoPE|1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine}}
−
{{#set: reconstruction source=primary_network}}
+
{{#set: consumed by=RXN-15035}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: produced by=RXN-15067}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: reversible reaction associated=RXN-15036}}
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+

Latest revision as of 19:37, 21 March 2018

Metabolite CPD-8355

  • smiles:
    • CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O
  • common name:
    • 1-18:1-2-lysophosphatidylethanolamine
  • inchi key:
    • InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N
  • molecular weight:
    • 479.593
  • Synonym(s):
    • 1-18:1-lysoPE
    • 1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-8355&oldid=42757"