Difference between revisions of "PWY-5857"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5857 PWY-5857] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-12...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5857 PWY-5857] ==
−
* smiles:
+
* taxonomic range:
−
** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
−
* inchi key:
+
−
** InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L
+
 
* common name:
 
* common name:
−
** gibberellin44 (open lactone form)
+
** ubiquinol-10 biosynthesis (prokaryotic)
−
* molecular weight:
+
−
** 362.422   
+
 
* Synonym(s):
 
* Synonym(s):
−
** gibberellin A44 open lactone
+
** Q10 biosynthesis
−
** gibberellin A44 diacid
+
** ubiquinone-10 biosynthesis (prokaryotic)
−
** GA44 open lactone
+
−
** GA44 (open lactone form)
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN1F-168]]
+
'''1''' reactions found over '''8''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-9235]]
−
* [[RXN1F-167]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_19352]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9230 RXN-9230]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9231 RXN-9231]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9232 RXN-9232]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9233 RXN-9233]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9234 RXN-9234]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9236 RXN-9236]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9237 RXN-9237]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104170008
+
{{#set: taxonomic range=TAX-1224}}
−
* PUBCHEM:
+
{{#set: common name=ubiquinol-10 biosynthesis (prokaryotic)}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243940 25243940]
+
{{#set: common name=Q10 biosynthesis|ubiquinone-10 biosynthesis (prokaryotic)}}
−
* CHEBI:
+
{{#set: reaction found=1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27531 27531]
+
{{#set: total reaction=8}}
−
* LIGAND-CPD:
+
{{#set: completion rate=13.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06095 C06095]
+
−
{{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
−
{{#set: inchi key=InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L}}
+
−
{{#set: common name=gibberellin44 (open lactone form)}}
+
−
{{#set: molecular weight=362.422    }}
+
−
{{#set: common name=gibberellin A44 open lactone|gibberellin A44 diacid|GA44 open lactone|GA44 (open lactone form)}}
+
−
{{#set: consumed by=RXN1F-168}}
+
−
{{#set: produced by=RXN1F-167}}
+

Latest revision as of 20:37, 21 March 2018

Pathway PWY-5857

  • taxonomic range:
  • common name:
    • ubiquinol-10 biosynthesis (prokaryotic)
  • Synonym(s):
    • Q10 biosynthesis
    • ubiquinone-10 biosynthesis (prokaryotic)

Reaction(s) found

1 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-5857&oldid=42793"