Difference between revisions of "CPD-8613"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7282 PWY-7282] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C |
* common name: | * common name: | ||
| − | ** 4- | + | ** 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol |
| + | * inchi key: | ||
| + | ** InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M | ||
| + | * molecular weight: | ||
| + | ** 443.688 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN66-18]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name=4- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826592 91826592] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87047 87047] |
| + | * HMDB : HMDB12165 | ||
| + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C}} | ||
| + | {{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol}} | ||
| + | {{#set: inchi key=InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M}} | ||
| + | {{#set: molecular weight=443.688 }} | ||
| + | {{#set: consumed by=RXN66-18}} | ||
Latest revision as of 19:37, 21 March 2018
Contents
Metabolite CPD-8613
- smiles:
- CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C
- common name:
- 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol
- inchi key:
- InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M
- molecular weight:
- 443.688
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.
