Difference between revisions of "5-HYDROXY-CONIFERALDEHYDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CONIFERALDEHYDE 5-HYDROXY-CONIFERALDEHYDE] == * smiles: ** COC1(=CC(C=CC=O)=CC(O)=C(O...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CONIFERALDEHYDE 5-HYDROXY-CONIFERALDEHYDE] == |
* smiles: | * smiles: | ||
| − | ** CC(C) | + | ** COC1(=CC(C=CC=O)=CC(O)=C(O)1) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 5-hydroxy-coniferaldehyde |
| + | * inchi key: | ||
| + | ** InChIKey=IEHPLRVWOHZKCS-NSCUHMNNSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 194.187 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-1143]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282094 5282094] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4445308.html 4445308] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=31134 31134] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles=CC(C) | + | ** [http://www.genome.jp/dbget-bin/www_bget?C12204 C12204] |
| − | {{#set: | + | {{#set: smiles=COC1(=CC(C=CC=O)=CC(O)=C(O)1)}} |
| − | {{#set: | + | {{#set: common name=5-hydroxy-coniferaldehyde}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=IEHPLRVWOHZKCS-NSCUHMNNSA-N}} |
| − | {{#set: consumed by= | + | {{#set: molecular weight=194.187 }} |
| + | {{#set: consumed by=RXN-1143}} | ||
Latest revision as of 19:37, 21 March 2018
Contents
Metabolite 5-HYDROXY-CONIFERALDEHYDE
- smiles:
- COC1(=CC(C=CC=O)=CC(O)=C(O)1)
- common name:
- 5-hydroxy-coniferaldehyde
- inchi key:
- InChIKey=IEHPLRVWOHZKCS-NSCUHMNNSA-N
- molecular weight:
- 194.187
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
