Difference between revisions of "CPD-8608"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_12434 == * Synonym(s): == Reactions associated == * GLYCEROL-KIN-RXN ** pantograph-athaliana ** pantograph-[[esiliculosus]...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_12434 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] ==
 +
* smiles:
 +
** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
 +
* common name:
 +
** 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol
 +
* inchi key:
 +
** InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N
 +
* molecular weight:
 +
** 442.724   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[GLYCEROL-KIN-RXN]]
+
* [[RXN66-13]]
** [[pantograph]]-[[athaliana]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[esiliculosus]]
+
* [[RXN66-12]]
** [[pantograph]]-[[creinhardtii]]
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[PWY-4261]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=GLYCEROL-KIN-RXN}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-4261}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15698824 15698824]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87060 87060]
 +
* HMDB : HMDB12159
 +
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
 +
{{#set: common name=4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol}}
 +
{{#set: inchi key=InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N}}
 +
{{#set: molecular weight=442.724    }}
 +
{{#set: consumed by=RXN66-13}}
 +
{{#set: produced by=RXN66-12}}

Latest revision as of 19:37, 21 March 2018

Metabolite CPD-8608

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
  • common name:
    • 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol
  • inchi key:
    • InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N
  • molecular weight:
    • 442.724
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.