Difference between revisions of "Tiso gene 13560"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)...")
(Created page with "Category:Gene == Gene Tiso_gene_13560 == * right end position: ** 5777 * transcription direction: ** POSITIVE * left end position: ** 3676 * centisome position: ** 59.0711...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] ==
+
== Gene Tiso_gene_13560 ==
−
* smiles:
+
* right end position:
−
** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
+
** 5777
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** cycloartenol
+
** 3676
−
* molecular weight:
+
* centisome position:
−
** 426.724    
+
** 59.07119    
 
* Synonym(s):
 
* Synonym(s):
−
** 9β,19-cyclo-24-lanosten-3β-ol
 
−
** cycloart-24(25)-enol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-4021]]
+
* Reaction: [[METHIONYL-TRNA-FORMYLTRANSFERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[CYCLOARTENOL-SYNTHASE-RXN]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CAS : 469-38-5
+
{{#set: right end position=5777}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44434254 44434254]
+
{{#set: left end position=3676}}
−
* CHEBI:
+
{{#set: centisome position=59.07119   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17030 17030]
+
{{#set: reaction associated=METHIONYL-TRNA-FORMYLTRANSFERASE-RXN}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01902 C01902]
+
−
* HMDB : HMDB36591
+
−
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
+
−
{{#set: inchi key=InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N}}
+
−
{{#set: common name=cycloartenol}}
+
−
{{#set: molecular weight=426.724   }}
+
−
{{#set: common name=9β,19-cyclo-24-lanosten-3β-ol|cycloart-24(25)-enol}}
+
−
{{#set: consumed by=RXN-4021}}
+
−
{{#set: produced by=CYCLOARTENOL-SYNTHASE-RXN}}
+

Latest revision as of 19:37, 21 March 2018

Gene Tiso_gene_13560

  • right end position:
    • 5777
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3676
  • centisome position:
    • 59.07119
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_13560&oldid=42842"