Difference between revisions of "D-GLT"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_1303 == * left end position: ** 34 * transcription direction: ** POSITIVE * right end position: ** 3832 * centisome position: ** 0.11923130...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] == * smiles: ** C(CCC(C(=O)[O-])[N+])([O-])=O * common name: ** D-glutamate * inch...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(CCC(C(=O)[O-])[N+])([O-])=O |
| − | * | + | * common name: |
| − | ** | + | ** D-glutamate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 146.122 |
* Synonym(s): | * Synonym(s): | ||
| + | ** D-glutamic acid | ||
| + | ** D-glu | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[D-ALANINE-AMINOTRANSFERASE-RXN]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 6893-26-1 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460297 5460297] |
| − | {{#set: | + | * HMDB : HMDB03339 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00217 C00217] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29986 29986] | ||
| + | * BIGG : glu__D | ||
| + | {{#set: smiles=C(CCC(C(=O)[O-])[N+])([O-])=O}} | ||
| + | {{#set: common name=D-glutamate}} | ||
| + | {{#set: inchi key=InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M}} | ||
| + | {{#set: molecular weight=146.122 }} | ||
| + | {{#set: common name=D-glutamic acid|D-glu}} | ||
| + | {{#set: reversible reaction associated=D-ALANINE-AMINOTRANSFERASE-RXN}} | ||
Latest revision as of 19:38, 21 March 2018
Contents
Metabolite D-GLT
- smiles:
- C(CCC(C(=O)[O-])[N+])([O-])=O
- common name:
- D-glutamate
- inchi key:
- InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M
- molecular weight:
- 146.122
- Synonym(s):
- D-glutamic acid
- D-glu
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CCC(C(=O)[O-])[N+])([O-])=O" cannot be used as a page name in this wiki.
