Difference between revisions of "PWY-5115"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ATROPINE ATROPINE] == * smiles: ** C[N+]1(C2(CC(CC1CC2)OC(=O)C(CO)C3(C=CC=CC=3))) * inchi key:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5115 PWY-5115] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5115 PWY-5115] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** GDP-L-galactose biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''2''' reactions found over '''2''' reactions in the full pathway |
| − | + | * [[RXN-1882]] | |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[Tiso_gene_6621]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN-7771]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_6621]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | * | + | * ARACYC: |
| − | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5115 PWY-5115] | |
| − | ** [http:// | + | {{#set: taxonomic range=TAX-3193}} |
| − | + | {{#set: common name=GDP-L-galactose biosynthesis}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=2}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:39, 21 March 2018
Pathway PWY-5115
- taxonomic range:
- common name:
- GDP-L-galactose biosynthesis
- Synonym(s):
Reaction(s) found
2 reactions found over 2 reactions in the full pathway
- RXN-1882
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-7771
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC:
