Difference between revisions of "RXN-8443"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXY-D-RIBOSE-1-PHOSPHATE DEOXY-D-RIBOSE-1-PHOSPHATE] == * smiles: ** C1(C(O)C(CO)OC1OP(=O)([O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8443 RXN-8443] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXY-D-RIBOSE-1-PHOSPHATE DEOXY-D-RIBOSE-1-PHOSPHATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8443 RXN-8443] ==
−
* smiles:
+
* direction:
−
** C1(C(O)C(CO)OC1OP(=O)([O-])[O-])
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=KBDKAJNTYKVSEK-VPENINKCSA-L
+
** [http://enzyme.expasy.org/EC/2.7.1.173 EC-2.7.1.173]
−
* common name:
+
−
** 2-deoxy-α-D-ribose 1-phosphate
+
−
* molecular weight:
+
−
** 212.096   
+
 
* Synonym(s):
 
* Synonym(s):
−
** deoxy-D-ribose 1-phosphate
 
−
** 2-deoxy-D-ribose-1-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[ATP]][c] '''+''' 1 [[CPD-8259]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[NICOTINATE_NUCLEOTIDE]][c]
−
* [[THYM-PHOSPH-RXN]]
+
* With common name(s):
−
* [[URA-PHOSPH-RXN]]
+
** 1 ATP[c] '''+''' 1 β-D-ribosylnicotinate[c] '''=>''' 1 H+[c] '''+''' 1 ADP[c] '''+''' 1 β-nicotinate D-ribonucleotide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18221]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_2752]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_19763]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_12827]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_19151]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_12828]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_12252]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_17530]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_8616]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_17047]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_9582]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_8480]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_4145]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_15010]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_19611]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_1696]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_12183]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_19579]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_6111]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_1894]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_4144]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_4902]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_13509]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_8561]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_17305]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_12450]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_17980]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_15483]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_18943]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_13724]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_12316]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_2262]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14059]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14030]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_16455]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_17795]]
 +
** Source: [[orthology-athaliana]]
 +
== Pathways  ==
 +
* [[PWY-5381]], pyridine nucleotide cycling (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5381 PWY-5381]
 +
** '''3''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23419734 23419734]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25568 25568]
−
* CHEMSPIDER:
+
* LIGAND-RXN:
−
** [http://www.chemspider.com/Chemical-Structure.10461471.html 10461471]
+
** [http://www.genome.jp/dbget-bin/www_bget?R03347 R03347]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57259 57259]
+
{{#set: ec number=EC-2.7.1.173}}
−
* BIGG : 2dr1p
+
{{#set: gene associated=Tiso_gene_18221|Tiso_gene_2752|Tiso_gene_19763|Tiso_gene_12827|Tiso_gene_19151|Tiso_gene_12828|Tiso_gene_12252|Tiso_gene_17530|Tiso_gene_8616|Tiso_gene_17047|Tiso_gene_9582|Tiso_gene_8480|Tiso_gene_4145|Tiso_gene_15010|Tiso_gene_19611|Tiso_gene_1696|Tiso_gene_12183|Tiso_gene_19579|Tiso_gene_6111|Tiso_gene_1894|Tiso_gene_4144|Tiso_gene_4902|Tiso_gene_13509|Tiso_gene_8561|Tiso_gene_17305|Tiso_gene_12450|Tiso_gene_17980|Tiso_gene_15483|Tiso_gene_18943|Tiso_gene_13724|Tiso_gene_12316|Tiso_gene_2262|Tiso_gene_14059|Tiso_gene_14030|Tiso_gene_16455|Tiso_gene_17795}}
−
* HMDB : HMDB01351
+
{{#set: in pathway=PWY-5381}}
−
{{#set: smiles=C1(C(O)C(CO)OC1OP(=O)([O-])[O-])}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=KBDKAJNTYKVSEK-VPENINKCSA-L}}
+
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
−
{{#set: common name=2-deoxy-α-D-ribose 1-phosphate}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=212.096    }}
+
−
{{#set: common name=deoxy-D-ribose 1-phosphate|2-deoxy-D-ribose-1-phosphate}}
+
−
{{#set: consumed or produced by=THYM-PHOSPH-RXN|URA-PHOSPH-RXN}}
+

Latest revision as of 19:40, 21 March 2018

Reaction RXN-8443

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ATP[c] + 1 β-D-ribosylnicotinate[c] => 1 H+[c] + 1 ADP[c] + 1 β-nicotinate D-ribonucleotide[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5381, pyridine nucleotide cycling (plants): PWY-5381
    • 3 reactions found over 11 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-8443&oldid=43102"