Difference between revisions of "CPD-8609"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5743 PWY-5743] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-200795 TAX-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5743 PWY-5743] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-200795 TAX-200795]
+
** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C
 
* common name:
 
* common name:
** 3-hydroxypropanoate cycle
+
** 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol
 +
* inchi key:
 +
** InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N
 +
* molecular weight:
 +
** 412.698   
 
* Synonym(s):
 
* Synonym(s):
** 3-hydroxypropionate/malyl-CoA cycle
 
** 3-hydroxypropionate cycle
 
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''4''' reaction(s) found
+
* [[RXN66-14]]
** [[METHYLMALONYL-COA-MUT-RXN]]
+
== Reaction(s) known to produce the compound ==
** [[PROPIONYL-COA-CARBOXY-RXN]]
+
* [[RXN66-13]]
** [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
+
* [[RXN-13707]]
** [[RXN-6383]]
+
== Reaction(s) of unknown directionality ==
== Reaction(s) not found ==
+
* '''7''' reaction(s) not found
+
** [http://metacyc.org/META/NEW-IMAGE?object=METHYLMALONYL-COA-EPIM-RXN METHYLMALONYL-COA-EPIM-RXN]
+
** [http://metacyc.org/META/NEW-IMAGE?object=MALYL-COA-LYASE-RXN MALYL-COA-LYASE-RXN]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8963 RXN-8963]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8974 RXN-8974]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8964 RXN-8964]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9086 RXN-9086]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9087 RXN-9087]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-200795}}
+
* PUBCHEM:
{{#set: common name=3-hydroxypropanoate cycle}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=167817 167817]
{{#set: common name=3-hydroxypropionate/malyl-CoA cycle|3-hydroxypropionate cycle}}
+
* CHEBI:
{{#set: reaction found=4}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78904 78904]
{{#set: reaction not found=7}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C}}
 +
{{#set: common name=4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol}}
 +
{{#set: inchi key=InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N}}
 +
{{#set: molecular weight=412.698    }}
 +
{{#set: consumed by=RXN66-14}}
 +
{{#set: produced by=RXN66-13|RXN-13707}}

Latest revision as of 19:40, 21 March 2018

Metabolite CPD-8609

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C
  • common name:
    • 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol
  • inchi key:
    • InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N
  • molecular weight:
    • 412.698
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C" cannot be used as a page name in this wiki.