Difference between revisions of "CPD-15526"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14060 == * left end position: ** 1681 * transcription direction: ** NEGATIVE * right end position: ** 4533 * centisome position: ** 28.6273...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15526 CPD-15526] == * smiles: ** CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3)) * common name:...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15526 CPD-15526] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3)) |
| − | * | + | * common name: |
| − | ** | + | ** cyclobutadipyrimidine |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=FUVBFHHFGQNFFS-UHFFFAOYSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 238.246 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[3.2.2.17-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659235 90659235] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38923 38923] |
| − | {{#set: | + | {{#set: smiles=CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3))}} |
| − | {{#set: | + | {{#set: common name=cyclobutadipyrimidine}} |
| + | {{#set: inchi key=InChIKey=FUVBFHHFGQNFFS-UHFFFAOYSA-N}} | ||
| + | {{#set: molecular weight=238.246 }} | ||
| + | {{#set: produced by=3.2.2.17-RXN}} | ||
Latest revision as of 19:40, 21 March 2018
Contents
Metabolite CPD-15526
- smiles:
- CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3))
- common name:
- cyclobutadipyrimidine
- inchi key:
- InChIKey=FUVBFHHFGQNFFS-UHFFFAOYSA-N
- molecular weight:
- 238.246
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
