Difference between revisions of "Tiso gene 11594"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15526 CPD-15526] == * smiles: ** CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3)) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_11594 == * Synonym(s): == Reactions associated == * Reaction: PROTEIN-KINASE-RXN ** Source: orthology-esiliculosus == Pathways ass...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_11594 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[PROTEIN-KINASE-RXN]] | |
| − | * [[ | + | ** Source: [[orthology-esiliculosus]] |
| − | == | + | == Pathways associated == |
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 19:40, 21 March 2018
Gene Tiso_gene_11594
- Synonym(s):
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: orthology-esiliculosus
