Difference between revisions of "PWY-6944"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SORBITOL SORBITOL] == * smiles: ** C(C(C(C(C(CO)O)O)O)O)O * inchi key: ** InChIKey=FBPFZTCFMRRE...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6944 PWY-6944] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SORBITOL SORBITOL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6944 PWY-6944] ==
−
* smiles:
+
* taxonomic range:
−
** C(C(C(C(C(CO)O)O)O)O)O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=FBPFZTCFMRRESA-JGWLITMVSA-N
+
 
* common name:
 
* common name:
−
** D-sorbitol
+
** androstenedione degradation
−
* molecular weight:
+
−
** 182.173   
+
 
* Synonym(s):
 
* Synonym(s):
−
** L-gulitol
 
−
** D-glucitol
 
−
** meglumine
 
−
** iso-sorbide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''15''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-12747]]
−
* [[RXN-7644]]
+
** 4 associated gene(s):
 +
*** [[Tiso_gene_18774]]
 +
*** [[Tiso_gene_897]]
 +
*** [[Tiso_gene_11016]]
 +
*** [[Tiso_gene_2957]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-12750]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_14026]]
 +
*** [[Tiso_gene_14027]]
 +
*** [[Tiso_gene_18839]]
 +
*** [[Tiso_gene_14262]]
 +
*** [[Tiso_gene_5857]]
 +
*** [[Tiso_gene_18838]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=1.13.11.25-RXN 1.13.11.25-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12691 RXN-12691]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12714 RXN-12714]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12715 RXN-12715]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12717 RXN-12717]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12718 RXN-12718]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12734 RXN-12734]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12735 RXN-12735]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12736 RXN-12736]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12746 RXN-12746]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12748 RXN-12748]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12749 RXN-12749]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12751 RXN-12751]
 
== External links  ==
 
== External links  ==
−
* CAS : 50-70-4
+
{{#set: taxonomic range=TAX-2}}
−
* METABOLIGHTS : MTBLC17924
+
{{#set: common name=androstenedione degradation}}
−
* DRUGBANK : DB01638
+
{{#set: reaction found=2}}
−
* PUBCHEM:
+
{{#set: total reaction=15}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5780 5780]
+
{{#set: completion rate=13.0}}
−
* HMDB : HMDB00247
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00794 C00794]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.5576.html 5576]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17924 17924]
+
−
* BIGG : sbt__D
+
−
{{#set: smiles=C(C(C(C(C(CO)O)O)O)O)O}}
+
−
{{#set: inchi key=InChIKey=FBPFZTCFMRRESA-JGWLITMVSA-N}}
+
−
{{#set: common name=D-sorbitol}}
+
−
{{#set: molecular weight=182.173    }}
+
−
{{#set: common name=L-gulitol|D-glucitol|meglumine|iso-sorbide}}
+
−
{{#set: consumed or produced by=RXN-7644}}
+

Latest revision as of 19:41, 21 March 2018

Pathway PWY-6944

  • taxonomic range:
  • common name:
    • androstenedione degradation
  • Synonym(s):

Reaction(s) found

2 reactions found over 15 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-6944&oldid=43198"