Difference between revisions of "ADENOSINE5TRIPHOSPHO5ADENOSINE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15013 RXN-15013] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE5TRIPHOSPHO5ADENOSINE ADENOSINE5TRIPHOSPHO5ADENOSINE] == * smiles: ** C(C3(C(C(C(N2(C1...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE5TRIPHOSPHO5ADENOSINE ADENOSINE5TRIPHOSPHO5ADENOSINE] == |
− | * | + | * smiles: |
− | ** | + | ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OCC6(C(C(C(N5(C4(=C(C(=NC=N4)N)N=C5)))O6)O)O) |
+ | * common name: | ||
+ | ** 5',5'''-diadenosine triphosphate | ||
+ | * inchi key: | ||
+ | ** InChIKey=QCICUPZZLIQAPA-XPWFQUROSA-K | ||
+ | * molecular weight: | ||
+ | ** 753.388 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** P1,P3-bis(5'-adenosyl)triphosphate | ||
+ | ** 5'Ap3A | ||
+ | ** adenosine 5'-(tetrahydrogen triphosphate), P''-5'-ester with adenosine | ||
+ | ** Ap3A | ||
+ | ** adenosine(5')triphospho(5')adenosine | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[BIS5-ADENOSYL-TRIPHOSPHATASE-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201180 25201180] |
− | {{#set: | + | * HMDB : HMDB01155 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58529 58529] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C06197 C06197] | ||
+ | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OCC6(C(C(C(N5(C4(=C(C(=NC=N4)N)N=C5)))O6)O)O)}} | ||
+ | {{#set: common name=5',5'''-diadenosine triphosphate}} | ||
+ | {{#set: inchi key=InChIKey=QCICUPZZLIQAPA-XPWFQUROSA-K}} | ||
+ | {{#set: molecular weight=753.388 }} | ||
+ | {{#set: common name=P1,P3-bis(5'-adenosyl)triphosphate|5'Ap3A|adenosine 5'-(tetrahydrogen triphosphate), P''-5'-ester with adenosine|Ap3A|adenosine(5')triphospho(5')adenosine}} | ||
+ | {{#set: consumed by=BIS5-ADENOSYL-TRIPHOSPHATASE-RXN}} |
Latest revision as of 19:41, 21 March 2018
Contents
Metabolite ADENOSINE5TRIPHOSPHO5ADENOSINE
- smiles:
- C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OCC6(C(C(C(N5(C4(=C(C(=NC=N4)N)N=C5)))O6)O)O)
- common name:
- 5',5-diadenosine triphosphate
- inchi key:
- InChIKey=QCICUPZZLIQAPA-XPWFQUROSA-K
- molecular weight:
- 753.388
- Synonym(s):
- P1,P3-bis(5'-adenosyl)triphosphate
- 5'Ap3A
- adenosine 5'-(tetrahydrogen triphosphate), P-5'-ester with adenosine
- Ap3A
- adenosine(5')triphospho(5')adenosine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])OCC6(C(C(C(N5(C4(=C(C(=NC=N4)N)N=C5)))O6)O)O)" cannot be used as a page name in this wiki.