Difference between revisions of "PWY-0"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=K-HEXANOYL-COA K-HEXANOYL-COA] == * smiles: ** CCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-0 PWY-0] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-40674]...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=K-HEXANOYL-COA K-HEXANOYL-COA] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-0 PWY-0] ==
* smiles:
+
* taxonomic range:
** CCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-40674]
* inchi key:
+
** InChIKey=NFOYYXQAVVYWKV-HDRQGHTBSA-J
+
 
* common name:
 
* common name:
** 3-oxohexanoyl-CoA
+
** putrescine degradation III
* molecular weight:
+
** 875.63   
+
 
* Synonym(s):
 
* Synonym(s):
** ketohexanoyl-CoA
 
** β-hexanoyl-CoA
 
** ketohexanoyl-coenzyme-A
 
** 3-ketohexanoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-12570]]
+
'''1''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-37]]
* [[RXN-12565]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_3513]]
 +
*** [[Tiso_gene_7322]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-0 RXN-0]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1 RXN-1]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-36 RXN-36]
 
== External links  ==
 
== External links  ==
* CAS : 19774-86-8
+
{{#set: taxonomic range=TAX-40674}}
* METABOLIGHTS : MTBLC27648
+
{{#set: common name=putrescine degradation III}}
* PUBCHEM:
+
{{#set: reaction found=1}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53239804 53239804]
+
{{#set: total reaction=4}}
* HMDB : HMDB03943
+
{{#set: completion rate=25.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05269 C05269]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62418 62418]
+
* BIGG : 3ohcoa
+
{{#set: smiles=CCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)=O}}
+
{{#set: inchi key=InChIKey=NFOYYXQAVVYWKV-HDRQGHTBSA-J}}
+
{{#set: common name=3-oxohexanoyl-CoA}}
+
{{#set: molecular weight=875.63    }}
+
{{#set: common name=ketohexanoyl-CoA|β-hexanoyl-CoA|ketohexanoyl-coenzyme-A|3-ketohexanoyl-CoA}}
+
{{#set: consumed by=RXN-12570}}
+
{{#set: produced by=RXN-12565}}
+

Latest revision as of 19:42, 21 March 2018

Pathway PWY-0

  • taxonomic range:
  • common name:
    • putrescine degradation III
  • Synonym(s):

Reaction(s) found

1 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links