Difference between revisions of "CPD-2744"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6799 PWY-6799] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] == * smiles: ** C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3)) |
* common name: | * common name: | ||
| − | ** | + | ** nicotine-glucuronide |
| + | * inchi key: | ||
| + | ** InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O | ||
| + | * molecular weight: | ||
| + | ** 339.367 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN66-83]] | |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820524 91820524] |
| − | {{#set: | + | * HMDB : HMDB01272 |
| − | {{#set: | + | {{#set: smiles=C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))}} |
| + | {{#set: common name=nicotine-glucuronide}} | ||
| + | {{#set: inchi key=InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O}} | ||
| + | {{#set: molecular weight=339.367 }} | ||
| + | {{#set: produced by=RXN66-83}} | ||
Latest revision as of 19:42, 21 March 2018
Contents
Metabolite CPD-2744
- smiles:
- C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))
- common name:
- nicotine-glucuronide
- inchi key:
- InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O
- molecular weight:
- 339.367
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB01272
"C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))" cannot be used as a page name in this wiki.
