Difference between revisions of "GLYOXDEG-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13694 CPD-13694] == * smiles: ** CC(CCC(O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYOXDEG-PWY GLYOXDEG-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 T...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13694 CPD-13694] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYOXDEG-PWY GLYOXDEG-PWY] ==
* smiles:
+
* taxonomic range:
** CC(CCC(O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=LPAPCIXIEIQRQA-OQRFGCRRSA-J
+
 
* common name:
 
* common name:
** 24-hydroxy-3-oxocholest-4-en-26-oyl-CoA
+
** glycolate and glyoxylate degradation II
* molecular weight:
+
** 1176.114   
+
 
* Synonym(s):
 
* Synonym(s):
** cholest-4-en-24-ol-3-one-26-oyl-CoA
+
** glyoxylate degradation
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-12705]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[MALSYN-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_14377]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLATEDEHYDRO-RXN GLYCOLATEDEHYDRO-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658714 90658714]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=GLYOXDEG-PWY GLYOXDEG-PWY]
{{#set: smiles=CC(CCC(O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: inchi key=InChIKey=LPAPCIXIEIQRQA-OQRFGCRRSA-J}}
+
{{#set: common name=glycolate and glyoxylate degradation II}}
{{#set: common name=24-hydroxy-3-oxocholest-4-en-26-oyl-CoA}}
+
{{#set: common name=glyoxylate degradation}}
{{#set: molecular weight=1176.114    }}
+
{{#set: reaction found=1}}
{{#set: common name=cholest-4-en-24-ol-3-one-26-oyl-CoA}}
+
{{#set: total reaction=2}}
{{#set: consumed by=RXN-12705}}
+
{{#set: completion rate=50.0}}

Latest revision as of 19:43, 21 March 2018

Pathway GLYOXDEG-PWY

  • taxonomic range:
  • common name:
    • glycolate and glyoxylate degradation II
  • Synonym(s):
    • glyoxylate degradation

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links