Difference between revisions of "CPD-12017"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHYLENETHFDEHYDROG-NADP-RXN METHYLENETHFDEHYDROG-NADP-RXN] == * direction: ** REVERSIBLE * common...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == * smiles: ** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12)) * common na...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHYLENETHFDEHYDROG-NADP-RXN METHYLENETHFDEHYDROG-NADP-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))
 
* common name:
 
* common name:
−
** ORF
+
** N-acetyl-serotonin sulfate
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.5.1.5 EC-1.5.1.5]
+
** InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 297.305   
 
* Synonym(s):
 
* Synonym(s):
 +
** N-acetyl-5-hydroxytryptamine sulfate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[METHYLENE-THF-GLU-N]][c] '''+''' 1 [[NADP]][c] '''<=>''' 1 [[5-10-METHENYL-THF-GLU-N]][c] '''+''' 1 [[NADPH]][c]
+
* [[RXN-11059]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a 5,10-methylene-tetrahydrofolate[c] '''+''' 1 NADP+[c] '''<=>''' 1 a 5,10-methenyltetrahydrofolate[c] '''+''' 1 NADPH[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_6004]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_432]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-1722]], formate assimilation into 5,10-methylenetetrahydrofolate: [http://metacyc.org/META/NEW-IMAGE?object=PWY-1722 PWY-1722]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-3841]], folate transformations II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3841 PWY-3841]
+
−
** '''9''' reactions found over '''11''' reactions in the full pathway
+
−
* [[1CMET2-PWY]], N10-formyl-tetrahydrofolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=1CMET2-PWY 1CMET2-PWY]
+
−
** '''7''' reactions found over '''9''' reactions in the full pathway
+
−
* [[CODH-PWY]], reductive acetyl coenzyme A pathway I (homoacetogenic bacteria): [http://metacyc.org/META/NEW-IMAGE?object=CODH-PWY CODH-PWY]
+
−
** '''5''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-5497]], purine nucleobases degradation II (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5497 PWY-5497]
+
−
** '''7''' reactions found over '''24''' reactions in the full pathway
+
−
* [[PWY-2201]], folate transformations I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2201 PWY-2201]
+
−
** '''7''' reactions found over '''12''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[manual]]:
+
−
** [[primary_network]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22812 22812]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102514958 102514958]
−
* LIGAND-RXN:
+
* HMDB : HMDB60834
−
** [http://www.genome.jp/dbget-bin/www_bget?R01220 R01220]
+
{{#set: smiles=CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))}}
−
* UNIPROT:
+
{{#set: common name=N-acetyl-serotonin sulfate}}
−
** [http://www.uniprot.org/uniprot/P09440 P09440]
+
{{#set: inchi key=InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M}}
−
** [http://www.uniprot.org/uniprot/P07245 P07245]
+
{{#set: molecular weight=297.305    }}
−
** [http://www.uniprot.org/uniprot/P11586 P11586]
+
{{#set: common name=N-acetyl-5-hydroxytryptamine sulfate}}
−
** [http://www.uniprot.org/uniprot/P44313 P44313]
+
{{#set: produced by=RXN-11059}}
−
** [http://www.uniprot.org/uniprot/P47259 P47259]
+
−
** [http://www.uniprot.org/uniprot/P54382 P54382]
+
−
** [http://www.uniprot.org/uniprot/O67736 O67736]
+
−
** [http://www.uniprot.org/uniprot/Q9JWI9 Q9JWI9]
+
−
** [http://www.uniprot.org/uniprot/Q9PP68 Q9PP68]
+
−
** [http://www.uniprot.org/uniprot/P24186 P24186]
+
−
** [http://www.uniprot.org/uniprot/Q60006 Q60006]
+
−
** [http://www.uniprot.org/uniprot/Q27772 Q27772]
+
−
** [http://www.uniprot.org/uniprot/P51696 P51696]
+
−
** [http://www.uniprot.org/uniprot/O65269 O65269]
+
−
** [http://www.uniprot.org/uniprot/O65271 O65271]
+
−
** [http://www.uniprot.org/uniprot/O68031 O68031]
+
−
** [http://www.uniprot.org/uniprot/Q9ZTV0 Q9ZTV0]
+
−
** [http://www.uniprot.org/uniprot/Q9X7F6 Q9X7F6]
+
−
{{#set: direction=REVERSIBLE}}
+
−
{{#set: common name=ORF}}
+
−
{{#set: ec number=EC-1.5.1.5}}
+
−
{{#set: gene associated=Tiso_gene_6004|Tiso_gene_432}}
+
−
{{#set: in pathway=PWY-1722|PWY-3841|1CMET2-PWY|CODH-PWY|PWY-5497|PWY-2201}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=esiliculosus}}
+
−
{{#set: reconstruction category=manual}}
+
−
{{#set: reconstruction source=primary_network}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=in-silico_annotation}}
+

Latest revision as of 20:43, 21 March 2018

Metabolite CPD-12017

  • smiles:
    • CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))
  • common name:
    • N-acetyl-serotonin sulfate
  • inchi key:
    • InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M
  • molecular weight:
    • 297.305
  • Synonym(s):
    • N-acetyl-5-hydroxytryptamine sulfate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-12017&oldid=43442"