Difference between revisions of "Tiso gene 11297"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] == * smiles: ** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2)) * inchi key: ** InCh...")
(Created page with "Category:Gene == Gene Tiso_gene_11297 == * right end position: ** 7171 * transcription direction: ** NEGATIVE * left end position: ** 4785 * centisome position: ** 60.6079...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] ==
+
== Gene Tiso_gene_11297 ==
−
* smiles:
+
* right end position:
−
** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))
+
** 7171
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** dehydroascorbate (bicyclic form)
+
** 4785
−
* molecular weight:
+
* centisome position:
−
** 192.125    
+
** 60.607983    
 
* Synonym(s):
 
* Synonym(s):
−
** dehydroascorbate monohydrate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12861]]
+
* Reaction: [[HISTCYCLOHYD-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-12862]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[HISTPRATPHYD-RXN]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[PRACH]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[PRADP]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[HISTSYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=7171}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659000 90659000]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))}}
+
{{#set: left end position=4785}}
−
{{#set: inchi key=InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N}}
+
{{#set: centisome position=60.607983   }}
−
{{#set: common name=dehydroascorbate (bicyclic form)}}
+
{{#set: reaction associated=HISTCYCLOHYD-RXN|HISTPRATPHYD-RXN|PRACH|PRADP}}
−
{{#set: molecular weight=192.125   }}
+
{{#set: pathway associated=HISTSYN-PWY}}
−
{{#set: common name=dehydroascorbate monohydrate}}
+
−
{{#set: consumed by=RXN-12861}}
+
−
{{#set: produced by=RXN-12862}}
+

Latest revision as of 19:43, 21 March 2018

Gene Tiso_gene_11297

  • right end position:
    • 7171
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 4785
  • centisome position:
    • 60.607983
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11297&oldid=43478"