Difference between revisions of "RXN-12789"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINOL HISTIDINOL] == * smiles: ** C1(NC=NC=1CC(CO)[N+]) * inchi key: ** InChIKey=ZQISRDCJN...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12789 RXN-12789] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-beta_hydroxysteroid_dehyd...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINOL HISTIDINOL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12789 RXN-12789] ==
−
* smiles:
+
* direction:
−
** C1(NC=NC=1CC(CO)[N+])
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O
+
 
* common name:
 
* common name:
−
** histidinol
+
** 3-beta_hydroxysteroid_dehydrogenase_isomerase
−
* molecular weight:
+
** ORF
−
** 142.18   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.1.1.145 EC-1.1.1.145]
 
* Synonym(s):
 
* Synonym(s):
−
** histidol
 
−
** L-histidinol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-8001]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NAD]][c] '''+''' 1 [[CPD-4143]][c] '''=>''' 1 [[CPD-13793]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c]
−
* [[HISTIDPHOS-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 NAD+[c] '''+''' 1 sitosterol[c] '''=>''' 1 3-oxo-24-ethyl-cholest-5-ene[c] '''+''' 1 H+[c] '''+''' 1 NADH[c]
−
* [[HISTOLDEHYD-RXN]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_11016]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_897]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_18774]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_2957]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6948]], sitosterol degradation to androstenedione: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6948 PWY-6948]
 +
** '''2''' reactions found over '''18''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 501-28-0
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=3-beta_hydroxysteroid_dehydrogenase_isomerase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6950298 6950298]
+
{{#set: common name=ORF}}
−
* KNAPSACK : C00007479
+
{{#set: ec number=EC-1.1.1.145}}
−
* HMDB : HMDB03431
+
{{#set: gene associated=Tiso_gene_11016|Tiso_gene_897|Tiso_gene_18774|Tiso_gene_2957}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-6948}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00860 C00860]
+
{{#set: reconstruction category=orthology|annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57699 57699]
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
* BIGG : histd
+
−
{{#set: smiles=C1(NC=NC=1CC(CO)[N+])}}
+
−
{{#set: inchi key=InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O}}
+
−
{{#set: common name=histidinol}}
+
−
{{#set: molecular weight=142.18    }}
+
−
{{#set: common name=histidol|L-histidinol}}
+
−
{{#set: consumed by=RXN-8001}}
+
−
{{#set: produced by=HISTIDPHOS-RXN}}
+
−
{{#set: consumed or produced by=HISTOLDEHYD-RXN}}
+

Latest revision as of 19:43, 21 March 2018

Reaction RXN-12789

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-beta_hydroxysteroid_dehydrogenase_isomerase
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD+[c] + 1 sitosterol[c] => 1 3-oxo-24-ethyl-cholest-5-ene[c] + 1 H+[c] + 1 NADH[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6948, sitosterol degradation to androstenedione: PWY-6948
    • 2 reactions found over 18 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-12789&oldid=43490"