Difference between revisions of "3-PHENYLPROPIONATE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8668 RXN-8668] == * direction: ** LEFT-TO-RIGHT * common name: ** leukocyte_receptor_cluster_me...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-PHENYLPROPIONATE 3-PHENYLPROPIONATE] == * smiles: ** C(CCC1(=CC=CC=C1))([O-])=O * common name...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-PHENYLPROPIONATE 3-PHENYLPROPIONATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(CCC1(=CC=CC=C1))([O-])=O |
* common name: | * common name: | ||
− | ** | + | ** 3-phenylpropanoate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=XMIIGOLPHOKFCH-UHFFFAOYSA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 149.169 |
* Synonym(s): | * Synonym(s): | ||
+ | ** hydrocinnamate | ||
+ | ** 3-phenylpropionic acid | ||
+ | ** hydrocinnamic acid | ||
+ | ** HCA | ||
+ | ** phenylpropanoate | ||
+ | ** 3-phenylpropionate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-18229]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4740700 4740700] |
− | * LIGAND- | + | * HMDB : HMDB00764 |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05629 C05629] | |
− | + | * CHEMSPIDER: | |
− | + | ** [http://www.chemspider.com/Chemical-Structure.3927902.html 3927902] | |
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=51057 51057] |
− | {{#set: | + | * BIGG : pppn |
− | {{#set: | + | {{#set: smiles=C(CCC1(=CC=CC=C1))([O-])=O}} |
− | {{#set: | + | {{#set: common name=3-phenylpropanoate}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=XMIIGOLPHOKFCH-UHFFFAOYSA-M}} |
− | {{#set: | + | {{#set: molecular weight=149.169 }} |
+ | {{#set: common name=hydrocinnamate|3-phenylpropionic acid|hydrocinnamic acid|HCA|phenylpropanoate|3-phenylpropionate}} | ||
+ | {{#set: produced by=RXN-18229}} |
Latest revision as of 20:44, 21 March 2018
Contents
Metabolite 3-PHENYLPROPIONATE
- smiles:
- C(CCC1(=CC=CC=C1))([O-])=O
- common name:
- 3-phenylpropanoate
- inchi key:
- InChIKey=XMIIGOLPHOKFCH-UHFFFAOYSA-M
- molecular weight:
- 149.169
- Synonym(s):
- hydrocinnamate
- 3-phenylpropionic acid
- hydrocinnamic acid
- HCA
- phenylpropanoate
- 3-phenylpropionate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CCC1(=CC=CC=C1))([O-])=O" cannot be used as a page name in this wiki.