Difference between revisions of "Tiso gene 20110"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] == * smiles: ** C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)...")
(Created page with "Category:Gene == Gene Tiso_gene_20110 == * right end position: ** 1719 * transcription direction: ** POSITIVE * left end position: ** 502 * centisome position: ** 28.66933...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] ==
+
== Gene Tiso_gene_20110 ==
* smiles:
+
* right end position:
** C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
+
** 1719
* inchi key:
+
* transcription direction:
** InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J
+
** POSITIVE
* common name:
+
* left end position:
** dUTP
+
** 502
* molecular weight:
+
* centisome position:
** 464.112    
+
** 28.66933    
 
* Synonym(s):
 
* Synonym(s):
** deoxy-UTP
 
** 2'-deoxyuridine-5'-triphosphate
 
** deoxyuridine-triphosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-14199]]
+
* Reaction: [[GSHTRAN-RXN]]
* [[DUTUP]]
+
** Source: [[annotation-in-silico_annotation]]
* [[DUTCP]]
+
*** Assignment: ec-number
* [[DUTNH]]
+
** Source: [[annotation-experimental_annotation]]
* [[RXN-14219]]
+
*** Assignment: ec-number
* [[DUTP-PYROP-RXN]]
+
* Reaction: [[GST-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
* [[ATDUDm]]
+
*** Assignment: ec-number
* [[ATDUD]]
+
** Source: [[annotation-experimental_annotation]]
* [[DUDPKIN-RXN]]
+
*** Assignment: ec-number
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-13673]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15680]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7112]]
 +
* [[PWY-6842]]
 +
* [[PWY-4061]]
 +
* [[PWY-7533]]
 
== External links  ==
 
== External links  ==
* CAS : 1173-82-6
+
{{#set: right end position=1719}}
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244408 25244408]
+
{{#set: left end position=502}}
* HMDB : HMDB01191
+
{{#set: centisome position=28.66933   }}
* LIGAND-CPD:
+
{{#set: reaction associated=GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}}
** [http://www.genome.jp/dbget-bin/www_bget?C00460 C00460]
+
{{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61555 61555]
+
* BIGG : dutp
+
{{#set: smiles=C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}}
+
{{#set: inchi key=InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J}}
+
{{#set: common name=dUTP}}
+
{{#set: molecular weight=464.112   }}
+
{{#set: common name=deoxy-UTP|2'-deoxyuridine-5'-triphosphate|deoxyuridine-triphosphate}}
+
{{#set: consumed by=RXN-14199|DUTUP|DUTCP|DUTNH|RXN-14219|DUTP-PYROP-RXN}}
+
{{#set: produced by=ATDUDm|ATDUD|DUDPKIN-RXN}}
+

Latest revision as of 20:44, 21 March 2018

Gene Tiso_gene_20110

  • right end position:
    • 1719
  • transcription direction:
    • POSITIVE
  • left end position:
    • 502
  • centisome position:
    • 28.66933
  • Synonym(s):

Reactions associated

Pathways associated

External links