Difference between revisions of "Tiso gene 19661"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-PHENYLPROPIONATE 3-PHENYLPROPIONATE] == * smiles: ** C(CCC1(=CC=CC=C1))([O-])=O * inchi key:...") |
(Created page with "Category:Gene == Gene Tiso_gene_19661 == * Synonym(s): == Reactions associated == * Reaction: GLUTAMIN-RXN ** Source: orthology-esiliculosus == Pathways associate...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_19661 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[GLUTAMIN-RXN]] | |
| − | * [[ | + | ** Source: [[orthology-esiliculosus]] |
| − | == | + | == Pathways associated == |
| + | * [[GLUTAMINDEG-PWY]] | ||
| + | * [[CITRULBIO-PWY]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=GLUTAMIN-RXN}} | |
| − | + | {{#set: pathway associated=GLUTAMINDEG-PWY|CITRULBIO-PWY}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 19:44, 21 March 2018
Gene Tiso_gene_19661
- Synonym(s):
Reactions associated
- Reaction: GLUTAMIN-RXN
- Source: orthology-esiliculosus
