Difference between revisions of "HACD5"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18118 CPD-18118] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HACD5 HACD5] == * direction: ** REVERSIBLE * common name: ** (S)-3-hydroxydodecanoyl-CoA:NAD oxidor...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HACD5 HACD5] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** (S)-3-hydroxydodecanoyl-CoA:NAD oxidoreductase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1.0 [[CPD0-2107]][x] '''+''' 1.0 [[NAD]][x] '''<=>''' 1.0 [[PROTON]][x] '''+''' 1.0 [[CPD0-2105]][x] '''+''' 1.0 [[NADH]][x] |
| − | == | + | * With common name(s): |
| + | ** 1.0 (S)-3-hydroxydodecanoyl-CoA[x] '''+''' 1.0 NAD+[x] '''<=>''' 1.0 H+[x] '''+''' 1.0 3-oxododecanoyl-CoA[x] '''+''' 1.0 NADH[x] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_5857]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=(S)-3-hydroxydodecanoyl-CoA:NAD oxidoreductase}} | |
| − | + | {{#set: gene associated=Tiso_gene_5857}} | |
| − | + | {{#set: in pathway=}} | |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| − | {{#set: | + | {{#set: reconstruction source=orthology-creinhardtii}} |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:44, 21 March 2018
Contents
Reaction HACD5
- direction:
- REVERSIBLE
- common name:
- (S)-3-hydroxydodecanoyl-CoA:NAD oxidoreductase
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1.0 (S)-3-hydroxydodecanoyl-CoA[x] + 1.0 NAD+[x] <=> 1.0 H+[x] + 1.0 3-oxododecanoyl-CoA[x] + 1.0 NADH[x]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_5857
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
