Difference between revisions of "HACD5"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18118 CPD-18118] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HACD5 HACD5] == * direction: ** REVERSIBLE * common name: ** (S)-3-hydroxydodecanoyl-CoA:NAD oxidor...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18118 CPD-18118] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=HACD5 HACD5] ==
* smiles:
+
* direction:
** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
+
** REVERSIBLE
* inchi key:
+
** InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L
+
 
* common name:
 
* common name:
** D-arabinofuranose 5-phosphate
+
** (S)-3-hydroxydodecanoyl-CoA:NAD oxidoreductase
* molecular weight:
+
** 228.095   
+
 
* Synonym(s):
 
* Synonym(s):
** D-arabinofuranose 5P
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[KDO-8PSYNTH-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[CPD0-2107]][x] '''+''' 1.0 [[NAD]][x] '''<=>''' 1.0 [[PROTON]][x] '''+''' 1.0 [[CPD0-2105]][x] '''+''' 1.0 [[NADH]][x]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 (S)-3-hydroxydodecanoyl-CoA[x] '''+''' 1.0 NAD+[x] '''<=>''' 1.0 H+[x] '''+''' 1.0 3-oxododecanoyl-CoA[x] '''+''' 1.0 NADH[x]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5857]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91825727 91825727]
+
{{#set: common name=(S)-3-hydroxydodecanoyl-CoA:NAD oxidoreductase}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_5857}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85971 85971]
+
{{#set: in pathway=}}
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}}
+
{{#set: reconstruction category=orthology}}
{{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-ZRMNMSDTSA-L}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: common name=D-arabinofuranose 5-phosphate}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: molecular weight=228.095    }}
+
{{#set: common name=D-arabinofuranose 5P}}
+
{{#set: consumed by=KDO-8PSYNTH-RXN}}
+

Latest revision as of 20:44, 21 March 2018

Reaction HACD5

  • direction:
    • REVERSIBLE
  • common name:
    • (S)-3-hydroxydodecanoyl-CoA:NAD oxidoreductase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 (S)-3-hydroxydodecanoyl-CoA[x] + 1.0 NAD+[x] <=> 1.0 H+[x] + 1.0 3-oxododecanoyl-CoA[x] + 1.0 NADH[x]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links