Difference between revisions of "6.3.4.11-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE SQUALENE] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=6.3.4.11-RXN 6.3.4.11-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=6.3.4.11-RXN 6.3.4.11-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/6.3.4.11 EC-6.3.4.11] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[BIOTIN]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[Apo-3-methylcrotonoyl-CoA-carbon-dioxide]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[3-methylcrotonoyl-CoA-carbon-dioxide]][c] |
− | == | + | * With common name(s): |
+ | ** 1 biotin[c] '''+''' 1 ATP[c] '''+''' 1 an apo-[3-methylcrotonoyl-CoA:carbon-dioxide ligase (ADP-forming)][c] '''=>''' 1 diphosphate[c] '''+''' 1 AMP[c] '''+''' 1 a holo-[3-methylcrotonoyl-CoA:carbon-dioxide ligase (ADP-forming)][c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_17216]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_8713]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04604 R04604] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-6.3.4.11}} | |
− | + | {{#set: gene associated=Tiso_gene_17216|Tiso_gene_8713}} | |
− | * LIGAND- | + | {{#set: in pathway=}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction category=orthology}} |
− | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:45, 21 March 2018
Contents
Reaction 6.3.4.11-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 BIOTIN[c] + 1 ATP[c] + 1 Apo-3-methylcrotonoyl-CoA-carbon-dioxide[c] => 1 PPI[c] + 1 AMP[c] + 1 3-methylcrotonoyl-CoA-carbon-dioxide[c]
- With common name(s):
- 1 biotin[c] + 1 ATP[c] + 1 an apo-[3-methylcrotonoyl-CoA:carbon-dioxide ligase (ADP-forming)][c] => 1 diphosphate[c] + 1 AMP[c] + 1 a holo-[3-methylcrotonoyl-CoA:carbon-dioxide ligase (ADP-forming)][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_17216
- Source: orthology-esiliculosus
- Gene: Tiso_gene_8713
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
- LIGAND-RXN: