Difference between revisions of "Tiso gene 16450"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-27 CPDQT-27] == * smiles: ** CSCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=GRUGZHAOXOPASC...")
(Created page with "Category:Gene == Gene Tiso_gene_16450 == * Synonym(s): == Reactions associated == * Reaction: UBIQUITIN-THIOLESTERASE-RXN ** Source: orthology-esiliculosus == Pat...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-27 CPDQT-27] ==
+
== Gene Tiso_gene_16450 ==
* smiles:
+
** CSCCCCC(=O)C([O-])=O
+
* inchi key:
+
** InChIKey=GRUGZHAOXOPASC-UHFFFAOYSA-M
+
* common name:
+
** 6-(methylthio)-2-oxohexanoate
+
* molecular weight:
+
** 175.222   
+
 
* Synonym(s):
 
* Synonym(s):
** 6-(methylthio)-2-oxohexanoic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[UBIQUITIN-THIOLESTERASE-RXN]]
* [[RXN-18209]]
+
** Source: [[orthology-esiliculosus]]
* [[RXNQT-4165]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=UBIQUITIN-THIOLESTERASE-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237195 44237195]
+
* KNAPSACK : C00007648
+
{{#set: smiles=CSCCCCC(=O)C([O-])=O}}
+
{{#set: inchi key=InChIKey=GRUGZHAOXOPASC-UHFFFAOYSA-M}}
+
{{#set: common name=6-(methylthio)-2-oxohexanoate}}
+
{{#set: molecular weight=175.222    }}
+
{{#set: common name=6-(methylthio)-2-oxohexanoic acid}}
+
{{#set: produced by=RXN-18209|RXNQT-4165}}
+

Latest revision as of 19:45, 21 March 2018

Gene Tiso_gene_16450

  • Synonym(s):

Reactions associated

Pathways associated

External links