Difference between revisions of "PRAISOM-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13912 CPD-13912] == * smiles: ** C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O * inchi key: ** InChI...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PRAISOM-RXN PRAISOM-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PRAISOM-RXN PRAISOM-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/5.3.1.24 EC-5.3.1.24] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[N-5-PHOSPHORIBOSYL-ANTHRANILATE]][c] '''=>''' 1 [[CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P]][c] |
− | == | + | * With common name(s): |
+ | ** 1 N-(5-phosphoribosyl)-anthranilate[c] '''=>''' 1 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_10297]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_10298]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | * [[TRPSYN-PWY]], L-tryptophan biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=TRPSYN-PWY TRPSYN-PWY] | ||
+ | ** '''6''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21540 21540] |
− | {{#set: | + | * LIGAND-RXN: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03509 R03509] |
− | {{#set: | + | * UNIPROT: |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P16923 P16923] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O67853 O67853] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P12289 P12289] |
+ | ** [http://www.uniprot.org/uniprot/P42393 P42393] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9PIF3 Q9PIF3] | ||
+ | ** [http://www.uniprot.org/uniprot/Q57893 Q57893] | ||
+ | ** [http://www.uniprot.org/uniprot/P20167 P20167] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9JVD1 Q9JVD1] | ||
+ | ** [http://www.uniprot.org/uniprot/P00910 P00910] | ||
+ | ** [http://www.uniprot.org/uniprot/P00909 P00909] | ||
+ | ** [http://www.uniprot.org/uniprot/P00912 P00912] | ||
+ | ** [http://www.uniprot.org/uniprot/P13997 P13997] | ||
+ | ** [http://www.uniprot.org/uniprot/P50857 P50857] | ||
+ | ** [http://www.uniprot.org/uniprot/P27710 P27710] | ||
+ | ** [http://www.uniprot.org/uniprot/P17218 P17218] | ||
+ | ** [http://www.uniprot.org/uniprot/P00908 P00908] | ||
+ | ** [http://www.uniprot.org/uniprot/P18483 P18483] | ||
+ | ** [http://www.uniprot.org/uniprot/Q02002 Q02002] | ||
+ | ** [http://www.uniprot.org/uniprot/Q56320 Q56320] | ||
+ | ** [http://www.uniprot.org/uniprot/Q01128 Q01128] | ||
+ | ** [http://www.uniprot.org/uniprot/P74435 P74435] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9YGB1 Q9YGB1] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: ec number=EC-5.3.1.24}} | ||
+ | {{#set: gene associated=Tiso_gene_10297|Tiso_gene_10298}} | ||
+ | {{#set: in pathway=TRPSYN-PWY}} | ||
+ | {{#set: reconstruction category=orthology|manual}} | ||
+ | {{#set: reconstruction source=manual-primary_network|orthology-creinhardtii|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Latest revision as of 20:45, 21 March 2018
Contents
Reaction PRAISOM-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 N-(5-phosphoribosyl)-anthranilate[c] => 1 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_10297
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Gene: Tiso_gene_10298
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
Pathways
- TRPSYN-PWY, L-tryptophan biosynthesis: TRPSYN-PWY
- 6 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-creinhardtii
- Category: manual
- Source: manual-primary_network
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: