Difference between revisions of "ATPPHOSPHORIBOSYLTRANS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) * i...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATPPHOSPHORIBOSYLTRANS-RXN ATPPHOSPHORIBOSYLTRANS-RXN] == * direction: ** REVERSIBLE * ec number: *...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATPPHOSPHORIBOSYLTRANS-RXN ATPPHOSPHORIBOSYLTRANS-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.4.2.17 EC-2.4.2.17] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[PPI]][c] '''+''' 1 [[PHOSPHORIBOSYL-ATP]][c] '''<=>''' 1 [[PRPP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ATP]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 diphosphate[c] '''+''' 1 1-(5-phospho-β-D-ribosyl)-ATP[c] '''<=>''' 1 5-phospho-α-D-ribose 1-diphosphate[c] '''+''' 1 H+[c] '''+''' 1 ATP[c] |
− | == | + | |
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[HISTSYN-PWY]], L-histidine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=HISTSYN-PWY HISTSYN-PWY] | ||
+ | ** '''10''' reactions found over '''10''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | * | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18473 18473] |
− | ** [http:// | + | * LIGAND-RXN: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01071 R01071] |
− | ** [http://www. | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9X0D2 Q9X0D2] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q58601 Q58601] |
− | + | ** [http://www.uniprot.org/uniprot/O34520 O34520] | |
− | + | ** [http://www.uniprot.org/uniprot/Q9RUE2 Q9RUE2] | |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P64347 P64347] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9PM78 Q9PM78] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q02129 Q02129] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P43853 P43853] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O67543 O67543] |
+ | ** [http://www.uniprot.org/uniprot/P40373 P40373] | ||
+ | ** [http://www.uniprot.org/uniprot/P46586 P46586] | ||
+ | ** [http://www.uniprot.org/uniprot/Q55503 Q55503] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9S762 Q9S762] | ||
+ | ** [http://www.uniprot.org/uniprot/P00498 P00498] | ||
+ | ** [http://www.uniprot.org/uniprot/P00499 P00499] | ||
+ | ** [http://www.uniprot.org/uniprot/P60757 P60757] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: ec number=EC-2.4.2.17}} | ||
+ | {{#set: in pathway=HISTSYN-PWY}} | ||
+ | {{#set: reconstruction category=manual}} | ||
+ | {{#set: reconstruction source=manual-primary_network}} |
Latest revision as of 19:47, 21 March 2018
Contents
Reaction ATPPHOSPHORIBOSYLTRANS-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PPI[c] + 1 PHOSPHORIBOSYL-ATP[c] <=> 1 PRPP[c] + 1 PROTON[c] + 1 ATP[c]
- With common name(s):
- 1 diphosphate[c] + 1 1-(5-phospho-β-D-ribosyl)-ATP[c] <=> 1 5-phospho-α-D-ribose 1-diphosphate[c] + 1 H+[c] + 1 ATP[c]
Genes associated with this reaction
Pathways
- HISTSYN-PWY, L-histidine biosynthesis: HISTSYN-PWY
- 10 reactions found over 10 reactions in the full pathway
Reconstruction information
- Category: manual
- Source: manual-primary_network
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: