Difference between revisions of "PWY-7185"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-NITROPHENOL P-NITROPHENOL] == * smiles: ** C1(C=C([O-])C=CC=1[N+](=O)[O-]) * inchi key: ** In...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7185 PWY-7185] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-NITROPHENOL P-NITROPHENOL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7185 PWY-7185] ==
−
* smiles:
+
* taxonomic range:
−
** C1(C=C([O-])C=CC=1[N+](=O)[O-])
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
** InChIKey=BTJIUGUIPKRLHP-UHFFFAOYSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** 4-nitrophenol
+
** UTP and CTP dephosphorylation I
−
* molecular weight:
+
−
** 138.102   
+
 
* Synonym(s):
 
* Synonym(s):
−
** p-nitrophenol
+
** pyrimidine nucleotides dephosphorylation
−
** PNP
+
−
** niphen
+
−
** 4-hydroxynitrobenzene
+
−
** para-nitrophenol
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''5''' reactions found over '''5''' reactions in the full pathway
−
* [[ARYLDIALKYL-PHOSPHATASE-RXN]]
+
* [[CTPSYN-RXN]]
−
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
** 0 associated gene:
−
* [[RXN-8746]]
+
** 3 reconstruction source(s) associated:
−
* [[RXN-8743]]
+
*** [[annotation-experimental_annotation]]
−
* [[RXN-17830]]
+
*** [[manual-primary_network]]
−
== Reaction(s) of unknown directionality ==
+
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-12199]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_20236]]
 +
*** [[Tiso_gene_12899]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-12200]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_20236]]
 +
*** [[Tiso_gene_12899]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-14025]]
 +
** 7 associated gene(s):
 +
*** [[Tiso_gene_14434]]
 +
*** [[Tiso_gene_6640]]
 +
*** [[Tiso_gene_13929]]
 +
*** [[Tiso_gene_6988]]
 +
*** [[Tiso_gene_14246]]
 +
*** [[Tiso_gene_5911]]
 +
*** [[Tiso_gene_14435]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-14026]]
 +
** 7 associated gene(s):
 +
*** [[Tiso_gene_6988]]
 +
*** [[Tiso_gene_6640]]
 +
*** [[Tiso_gene_13929]]
 +
*** [[Tiso_gene_5911]]
 +
*** [[Tiso_gene_14435]]
 +
*** [[Tiso_gene_14434]]
 +
*** [[Tiso_gene_14246]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* CAS : 100-02-7
+
{{#set: taxonomic range=TAX-2157}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=644235 644235]
+
{{#set: taxonomic range=TAX-2}}
−
* HMDB : HMDB01232
+
{{#set: common name=UTP and CTP dephosphorylation I}}
−
* LIGAND-CPD:
+
{{#set: common name=pyrimidine nucleotides dephosphorylation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00870 C00870]
+
{{#set: reaction found=5}}
−
* CHEMSPIDER:
+
{{#set: total reaction=5}}
−
** [http://www.chemspider.com/Chemical-Structure.559254.html 559254]
+
{{#set: completion rate=100.0}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57917 57917]
+
−
* METABOLIGHTS : MTBLC57917
+
−
{{#set: smiles=C1(C=C([O-])C=CC=1[N+](=O)[O-])}}
+
−
{{#set: inchi key=InChIKey=BTJIUGUIPKRLHP-UHFFFAOYSA-M}}
+
−
{{#set: common name=4-nitrophenol}}
+
−
{{#set: molecular weight=138.102    }}
+
−
{{#set: common name=p-nitrophenol|PNP|niphen|4-hydroxynitrobenzene|para-nitrophenol}}
+
−
{{#set: produced by=ARYLDIALKYL-PHOSPHATASE-RXN|4-NITROPHENYLPHOSPHATASE-RXN|RXN-8746|RXN-8743|RXN-17830}}
+

Latest revision as of 19:47, 21 March 2018

Pathway PWY-7185

  • taxonomic range:
  • common name:
    • UTP and CTP dephosphorylation I
  • Synonym(s):
    • pyrimidine nucleotides dephosphorylation

Reaction(s) found

5 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-7185&oldid=43778"