Difference between revisions of "Tiso gene 865"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] == * smiles: ** C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2)) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_865 == * right end position: ** 7455 * transcription direction: ** NEGATIVE * left end position: ** 3095 * centisome position: ** 11.072157...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_865 == |
| − | * | + | * right end position: |
| − | ** | + | ** 7455 |
| − | * | + | * transcription direction: |
| − | ** | + | ** NEGATIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 3095 |
| − | * | + | * centisome position: |
| − | ** | + | ** 11.072157 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[DNA-DIRECTED-DNA-POLYMERASE-RXN]] | |
| − | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
| − | == | + | *** Assignment: ec-number |
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: right end position=7455}} | |
| − | + | {{#set: transcription direction=NEGATIVE}} | |
| − | {{#set: | + | {{#set: left end position=3095}} |
| − | {{#set: | + | {{#set: centisome position=11.072157 }} |
| − | {{#set: | + | {{#set: reaction associated=DNA-DIRECTED-DNA-POLYMERASE-RXN}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:47, 21 March 2018
Gene Tiso_gene_865
- right end position:
- 7455
- transcription direction:
- NEGATIVE
- left end position:
- 3095
- centisome position:
- 11.072157
- Synonym(s):
Reactions associated
- Reaction: DNA-DIRECTED-DNA-POLYMERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
