Difference between revisions of "CPD-7196"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-218 TRANS-RXN-218] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula ==...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7196 CPD-7196] == * smiles: ** CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-218 TRANS-RXN-218] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7196 CPD-7196] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)
 +
* common name:
 +
** 9-cis-violaxanthin
 +
* inchi key:
 +
** InChIKey=SZCBXWMUOPQSOX-NLNQYMAJSA-N
 +
* molecular weight:
 +
** 600.88   
 
* Synonym(s):
 
* Synonym(s):
 +
** 9-c-violaxanthin
 +
** 9cViol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7974]]
−
** 2 [[PROTON]][c] '''=>''' 2 [[PROTON]][e]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 2 H+[c] '''=>''' 2 H+[e]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: in pathway=}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282218 5282218]
−
{{#set: reconstruction category=annotation}}
+
* CHEBI:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35305 35305]
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C13433 C13433]
 +
{{#set: smiles=CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)}}
 +
{{#set: common name=9-cis-violaxanthin}}
 +
{{#set: inchi key=InChIKey=SZCBXWMUOPQSOX-NLNQYMAJSA-N}}
 +
{{#set: molecular weight=600.88    }}
 +
{{#set: common name=9-c-violaxanthin|9cViol}}
 +
{{#set: consumed by=RXN-7974}}

Latest revision as of 19:47, 21 March 2018

Metabolite CPD-7196

  • smiles:
    • CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)
  • common name:
    • 9-cis-violaxanthin
  • inchi key:
    • InChIKey=SZCBXWMUOPQSOX-NLNQYMAJSA-N
  • molecular weight:
    • 600.88
  • Synonym(s):
    • 9-c-violaxanthin
    • 9cViol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-7196&oldid=43797"