Difference between revisions of "Tiso gene 5177"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11411 CPD-11411] == * smiles: ** C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(=CC(I)=C(C(I)=C2...")
(Created page with "Category:Gene == Gene Tiso_gene_5177 == * right end position: ** 4000 * transcription direction: ** POSITIVE * left end position: ** 2286 * centisome position: ** 16.54723...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11411 CPD-11411] ==
+
== Gene Tiso_gene_5177 ==
* smiles:
+
* right end position:
** C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(=CC(I)=C(C(I)=C2)OC3(C=C(I)C(O)=C(I)C=3))
+
** 4000
* inchi key:
+
* transcription direction:
** InChIKey=XZMJVZBEXSKSSM-KFYUBCHVSA-M
+
** POSITIVE
* common name:
+
* left end position:
** tetraiodothyroacetate ester glucuronide
+
** 2286
* molecular weight:
+
* centisome position:
** 922.95    
+
** 16.547232    
 
* Synonym(s):
 
* Synonym(s):
** tetraiodothyroacetic acid ester glucuronide
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
* [[RXN-10617]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=4000}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657880 90657880]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(=CC(I)=C(C(I)=C2)OC3(C=C(I)C(O)=C(I)C=3))}}
+
{{#set: left end position=2286}}
{{#set: inchi key=InChIKey=XZMJVZBEXSKSSM-KFYUBCHVSA-M}}
+
{{#set: centisome position=16.547232   }}
{{#set: common name=tetraiodothyroacetate ester glucuronide}}
+
{{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}}
{{#set: molecular weight=922.95   }}
+
{{#set: common name=tetraiodothyroacetic acid ester glucuronide}}
+
{{#set: produced by=RXN-10617}}
+

Latest revision as of 19:47, 21 March 2018

Gene Tiso_gene_5177

  • right end position:
    • 4000
  • transcription direction:
    • POSITIVE
  • left end position:
    • 2286
  • centisome position:
    • 16.547232
  • Synonym(s):

Reactions associated

Pathways associated

External links