Difference between revisions of "BTUR2-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONO-1-4-LACTONE L-GULONO-1-4-LACTONE] == * smiles: ** C(C([CH]1(C(C(C(O1)=O)O)O))O)O * inc...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BTUR2-RXN BTUR2-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BTUR2-RXN BTUR2-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/2.5.1.17 EC-2.5.1.17] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[COBINAMIDE]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[P3I]][c] '''+''' 1 [[ADENOSYLCOBINAMIDE]][c] |
− | == | + | * With common name(s): |
+ | ** 1 cobinamide[c] '''+''' 1 ATP[c] '''=>''' 1 PPPi[c] '''+''' 1 adenosylcobinamide[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_6190]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[COBALSYN-PWY]], adenosylcobalamin salvage from cobinamide I: [http://metacyc.org/META/NEW-IMAGE?object=COBALSYN-PWY COBALSYN-PWY] | ||
+ | ** '''2''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-6269]], adenosylcobalamin salvage from cobinamide II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6269 PWY-6269] | ||
+ | ** '''2''' reactions found over '''7''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14725 14725] |
− | + | * LIGAND-RXN: | |
− | * LIGAND- | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07268 R07268] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: ec number=EC-2.5.1.17}} | |
− | + | {{#set: gene associated=Tiso_gene_6190}} | |
− | + | {{#set: in pathway=COBALSYN-PWY|PWY-6269}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:47, 21 March 2018
Contents
Reaction BTUR2-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 COBINAMIDE[c] + 1 ATP[c] => 1 P3I[c] + 1 ADENOSYLCOBINAMIDE[c]
- With common name(s):
- 1 cobinamide[c] + 1 ATP[c] => 1 PPPi[c] + 1 adenosylcobinamide[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_6190
- Source: orthology-esiliculosus
Pathways
- COBALSYN-PWY, adenosylcobalamin salvage from cobinamide I: COBALSYN-PWY
- 2 reactions found over 6 reactions in the full pathway
- PWY-6269, adenosylcobalamin salvage from cobinamide II: PWY-6269
- 2 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links