Difference between revisions of "CPD-9758"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16S-rRNA-uracil1498 16S-rRNA-uracil1498] == * common name: ** a uracil1498 in 16S rRNA * Synony...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9758 CPD-9758] == * smiles: ** CC(=CCCC(=CCOC(C)=O)C)C * common name: ** geranyl acetate *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16S-rRNA-uracil1498 16S-rRNA-uracil1498] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9758 CPD-9758] ==
 +
* smiles:
 +
** CC(=CCCC(=CCOC(C)=O)C)C
 
* common name:
 
* common name:
** a uracil1498 in 16S rRNA
+
** geranyl acetate
 +
* inchi key:
 +
** InChIKey=HIGQPQRQIQDZMP-DHZHZOJOSA-N
 +
* molecular weight:
 +
** 196.289   
 
* Synonym(s):
 
* Synonym(s):
 +
** geraniol acetate
 +
** neryl acetate
 +
** geranyl acetate, cis-
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11598]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9192]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a uracil1498 in 16S rRNA}}
+
* PUBCHEM:
{{#set: consumed by=RXN-11598}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1549026 1549026]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.1266019.html 1266019]
 +
* HMDB : HMDB35157
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=5331 5331]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C09861 C09861]
 +
{{#set: smiles=CC(=CCCC(=CCOC(C)=O)C)C}}
 +
{{#set: common name=geranyl acetate}}
 +
{{#set: inchi key=InChIKey=HIGQPQRQIQDZMP-DHZHZOJOSA-N}}
 +
{{#set: molecular weight=196.289    }}
 +
{{#set: common name=geraniol acetate|neryl acetate|geranyl acetate, cis-}}
 +
{{#set: produced by=RXN-9192}}

Latest revision as of 19:48, 21 March 2018

Metabolite CPD-9758

  • smiles:
    • CC(=CCCC(=CCOC(C)=O)C)C
  • common name:
    • geranyl acetate
  • inchi key:
    • InChIKey=HIGQPQRQIQDZMP-DHZHZOJOSA-N
  • molecular weight:
    • 196.289
  • Synonym(s):
    • geraniol acetate
    • neryl acetate
    • geranyl acetate, cis-

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links