Difference between revisions of "UDPGtni"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-RIBULOSE D-RIBULOSE] == * smiles: ** C(O)C(O)C(O)C(=O)CO * inchi key: ** InChIKey=ZAQJHHRNXZU...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UDPGtni UDPGtni] == * direction: ** LEFT-TO-RIGHT * common name: ** UDP-glucose ABC transporter, nu...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-RIBULOSE D-RIBULOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=UDPGtni UDPGtni] ==
* smiles:
+
* direction:
** C(O)C(O)C(O)C(=O)CO
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=ZAQJHHRNXZUBTE-NQXXGFSBSA-N
+
 
* common name:
 
* common name:
** D-ribulose
+
** UDP-glucose ABC transporter, nuclear
* molecular weight:
+
** 150.131   
+
 
* Synonym(s):
 
* Synonym(s):
** D-erythro-pentulose
 
** D-erythropentulose
 
** erythropentulose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1.0 [[ATP]][c] '''+''' 1.0 [[CPD-12575]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[Pi]][c] '''+''' 1.0 [[ADP]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[CPD-12575]][n]
* [[D-RIBULOKIN-RXN]]
+
* With common name(s):
* [[RIBITOL-2-DEHYDROGENASE-RXN]]
+
** 1.0 ATP[c] '''+''' 1.0 UDP-α-D-glucose[c] '''+''' 1.0 H2O[c] '''=>''' 1.0 phosphate[c] '''+''' 1.0 ADP[c] '''+''' 1.0 H+[c] '''+''' 1.0 UDP-α-D-glucose[n]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5014]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 5556-48-9
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=UDP-glucose ABC transporter, nuclear}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=151261 151261]
+
{{#set: gene associated=Tiso_gene_5014}}
* HMDB : HMDB00621
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C00309 C00309]
+
{{#set: reconstruction source=orthology-creinhardtii}}
* CHEMSPIDER:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.chemspider.com/Chemical-Structure.133316.html 133316]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17173 17173]
+
* METABOLIGHTS : MTBLC17173
+
{{#set: smiles=C(O)C(O)C(O)C(=O)CO}}
+
{{#set: inchi key=InChIKey=ZAQJHHRNXZUBTE-NQXXGFSBSA-N}}
+
{{#set: common name=D-ribulose}}
+
{{#set: molecular weight=150.131    }}
+
{{#set: common name=D-erythro-pentulose|D-erythropentulose|erythropentulose}}
+
{{#set: consumed or produced by=D-RIBULOKIN-RXN|RIBITOL-2-DEHYDROGENASE-RXN}}
+

Latest revision as of 19:48, 21 March 2018

Reaction UDPGtni

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • UDP-glucose ABC transporter, nuclear
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 ATP[c] + 1.0 UDP-α-D-glucose[c] + 1.0 H2O[c] => 1.0 phosphate[c] + 1.0 ADP[c] + 1.0 H+[c] + 1.0 UDP-α-D-glucose[n]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links